{ "schema": "mol2mat.article-optimization/v1", "date": "2026-10-10", "performance": [ { "engine": "prediction", "fixture": "acyl-primary-amine", "baselineMedianMs": 115, "currentMedianMs": 82.19999998807907, "reductionPercent": 28.521739140800804, "speedup": 1.3990267641931593, "rounds": 3, "values": { "before": [ 115.19999998807907, 110.09999996423721, 115 ], "after": [ 82.19999998807907, 80.79999995231628, 82.79999995231628 ] } }, { "engine": "prediction", "fixture": "chiral-acylation", "baselineMedianMs": 223.69999998807907, "currentMedianMs": 148, "reductionPercent": 33.83996423429285, "speedup": 1.5114864864059396, "rounds": 3, "values": { "before": [ 220.30000001192093, 224.19999998807907, 223.69999998807907 ], "after": [ 138.60000002384186, 149, 148 ] } } ], "build": { "previousWorker": { "id": "prediction-worker", "key": "prediction-worker", "sha256": "7144717c3cb4a061d99c6049da9416c5c7ad861975f6010832f69b91aaf332d4", "byteLength": 110070, "mediaType": "text/javascript", "manifestId": "prediction-original-fp32-cpu-v2", "licenceReceiptId": "prediction-third-party-notices:b2067e40b935d38f11bcd7a2af55e65fe5f1a5ef830fd1e7e44f04eaf57b8f3b", "path": "/compute/prediction/7144717c3cb4a061d99c6049da9416c5c7ad861975f6010832f69b91aaf332d4.js" }, "currentWorker": { "id": "prediction-worker", "key": "prediction-worker", "sha256": "db763a3d22d5a2b4c47dceca233f1d6bab58d76ab1e8a2302371f3c591cdf842", "byteLength": 110273, "mediaType": "text/javascript", "manifestId": "prediction-original-fp32-cpu-v2", "licenceReceiptId": "prediction-third-party-notices:b2067e40b935d38f11bcd7a2af55e65fe5f1a5ef830fd1e7e44f04eaf57b8f3b", "path": "/compute/prediction/db763a3d22d5a2b4c47dceca233f1d6bab58d76ab1e8a2302371f3c591cdf842.js" }, "sourceRevision": "1df429ada079990d3feff963f12848018eb90b815dc62de720f072104865e848", "numericalAssetsIdentical": true, "checks": 17 }, "pairedWorker": { "status": "passed", "rows": [ { "id": "acyl-primary-amine", "repeat": 0, "variant": "before", "wallMs": 127.59999996423721, "computeMs": 122.5, "exact": true, "progressEvents": 11 }, { "id": "acyl-primary-amine", "repeat": 0, "variant": "after", "wallMs": 87.20000004768372, "computeMs": 82.30000001192093, "exact": true, "progressEvents": 11 }, { "id": "acyl-primary-amine", "repeat": 1, "variant": "after", "wallMs": 82.19999998807907, "computeMs": 81.39999997615814, "exact": true, "progressEvents": 11 }, { "id": "acyl-primary-amine", "repeat": 1, "variant": "before", "wallMs": 115.19999998807907, "computeMs": 114.20000004768372, "exact": true, "progressEvents": 11 }, { "id": "acyl-primary-amine", "repeat": 2, "variant": "before", "wallMs": 110.09999996423721, "computeMs": 109.20000004768372, "exact": true, "progressEvents": 11 }, { "id": "acyl-primary-amine", "repeat": 2, "variant": "after", "wallMs": 80.79999995231628, "computeMs": 80, "exact": true, "progressEvents": 11 }, { "id": "acyl-primary-amine", "repeat": 3, "variant": "after", "wallMs": 82.79999995231628, "computeMs": 81.89999997615814, "exact": true, "progressEvents": 11 }, { "id": "acyl-primary-amine", "repeat": 3, "variant": "before", "wallMs": 115, "computeMs": 114.09999996423721, "exact": true, "progressEvents": 11 }, { "id": "chiral-acylation", "repeat": 0, "variant": "before", "wallMs": 224.30000001192093, "computeMs": 223.30000001192093, "exact": true, "progressEvents": 19 }, { "id": "chiral-acylation", "repeat": 0, "variant": "after", "wallMs": 150.80000001192093, "computeMs": 149.9000000357628, "exact": true, "progressEvents": 19 }, { "id": "chiral-acylation", "repeat": 1, "variant": "after", "wallMs": 138.60000002384186, "computeMs": 137.70000004768372, "exact": true, "progressEvents": 19 }, { "id": "chiral-acylation", "repeat": 1, "variant": "before", "wallMs": 220.30000001192093, "computeMs": 219.5, "exact": true, "progressEvents": 19 }, { "id": "chiral-acylation", "repeat": 2, "variant": "before", "wallMs": 224.19999998807907, "computeMs": 223.19999998807907, "exact": true, "progressEvents": 19 }, { "id": "chiral-acylation", "repeat": 2, "variant": "after", "wallMs": 149, "computeMs": 148.19999998807907, "exact": true, "progressEvents": 19 }, { "id": "chiral-acylation", "repeat": 3, "variant": "after", "wallMs": 148, "computeMs": 147, "exact": true, "progressEvents": 19 }, { "id": "chiral-acylation", "repeat": 3, "variant": "before", "wallMs": 223.69999998807907, "computeMs": 222.79999995231628, "exact": true, "progressEvents": 19 } ], "cancelMs": 14.699999988079071, "retry": true, "initialization": { "before": 709.3000000119209, "after": 621.6999999880791 }, "scope": "Real distribution workers, includes task protocol/progress and result transfer; excludes assets and initialization; repeat 0 warmup" }, "currentAcceptance": { "status": "passed", "kind": "prediction", "sourceRevision": "1df429ada079990d3feff963f12848018eb90b815dc62de720f072104865e848", "implementationDigest": "9ba10bb450b9fc412dfc6acdcf2d8761fe6507645cc3265484b791dcde8622fa", "browserIdentity": { "userAgent": "Mozilla/5.0 (Macintosh; Intel Mac OS X 10_15_7) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/155.0.0.0 Safari/537.36", "maxTouchPoints": 0, "deviceClass": "desktop" }, "checks": [ { "id": "acyl-primary-amine", "status": "passed", "networkBytes": 0, "receipt": { "identity": { "taskId": "candidate-prediction:d5d7af3a-6f1d-4c0d-8e46-81c40a68f75d", "attemptId": "attempt:505330e9-4374-4f29-b416-00f9d62166cb", "generation": 1 }, "taskType": "reaction.product-prediction", "scientificProfileDigest": "72a1584ff8787ad3e0ed91021c054ef4b8869cdd79082c08f3f0561371240177", "implementationDigest": "9ba10bb450b9fc412dfc6acdcf2d8761fe6507645cc3265484b791dcde8622fa", "qualificationId": "prediction-fp32-q3-v2-product-v1", "normalizedInputHash": "29a9e3684a99ea0f3c3497b323d95d39713a8e6ce50472ad1d564e780589e688", "device": { "id": "candidate-prediction", "target": "browser", "class": "desktop", "connection": "online", "protocolVersion": 1, "implementationDigests": [ "9ba10bb450b9fc412dfc6acdcf2d8761fe6507645cc3265484b791dcde8622fa" ] }, "sourceReceipts": [ { "kind": "runtime", "build": "rolldown-1.0.3:sha256:db763a3d22d5a2b4c47dceca233f1d6bab58d76ab1e8a2302371f3c591cdf842", "concurrency": 1, "variant": "serial", "memoryBudgetBytes": 1610612736 } ], "parentResults": [], "startedAt": "2026-10-10T00:20:05.720Z", "endedAt": "2026-10-10T00:20:06.696Z", "wallSeconds": 0.976, "cpuSeconds": null, "peakResidentBytes": null, "quality": "complete", "warnings": [] }, "payload": { "reactants": "CC(=O)Cl.CCN", "candidates": [ { "smiles": "CCNC(C)=O", "formula": "C4H9NO", "model_score": -0.15758651494979858, "rank": 1 }, { "smiles": "CCNC(=O)CCl", "formula": "C4H8ClNO", "model_score": -3.866804599761963, "rank": 2 } ], "rejected_candidates": 1, "unknown_tokens": [], "conditions_modeled": false, "unspecified_stereo_candidates": [], "decoder_steps": 11, "hypotheses": [ { "tokenIDs": [ 5, 5, 12, 5, 6, 5, 7, 11, 9 ], "score": -0.15758651494979858, "finishedAt": 9, "endedWithEOS": true }, { "tokenIDs": [ 5, 5, 12, 5, 6, 11, 9, 7, 5 ], "score": -3.8236870765686035, "finishedAt": 9, "endedWithEOS": true }, { "tokenIDs": [ 5, 5, 12, 5, 6, 11, 9, 7, 5, 17 ], "score": -3.866804599761963, "finishedAt": 10, "endedWithEOS": true }, { "tokenIDs": [ 5, 5, 6, 11, 9, 7, 12, 5, 5 ], "score": -4.63646125793457, "finishedAt": 9, "endedWithEOS": true }, { "tokenIDs": [ 5, 5, 12, 5, 6, 11, 9, 7, 5, 5 ], "score": -5.346241474151611, "finishedAt": 10, "endedWithEOS": true } ], "trace": [ { "step": 0, "inputTokenIDs": [ 2 ], "topCandidateParents": [ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ], "topCandidateTokenIDs": [ 5, 12, 9, 4, 17, 45, 13, 39, 23, 21 ], "topCandidateScores": [ -0.01610320806503296, -5.04779577255249, -5.530431270599365, -5.803861141204834, -6.543020725250244, -8.412798881530762, -8.652434349060059, -9.436460494995117, -9.52953815460205, -9.564370155334473 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 1.8697781562805176 }, { "step": 1, "inputTokenIDs": [ 5, 12, 9, 4, 17 ], "topCandidateParents": [ 0, 0, 1, 2, 3, 0, 0, 4, 1, 0 ], "topCandidateTokenIDs": [ 5, 6, 6, 11, 8, 11, 12, 5, 5, 9 ], "topCandidateScores": [ -0.046237148344516754, -3.782909870147705, -5.320468425750732, -5.654323101043701, -5.803861141204834, -6.468499183654785, -6.488767623901367, -6.641310214996338, -6.6599836349487305, -6.902746200561523 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.6646380424499512 }, { "step": 2, "inputTokenIDs": [ 5, 6, 6, 11, 8 ], "topCandidateParents": [ 0, 0, 1, 1, 2, 0, 1, 3, 4, 0 ], "topCandidateTokenIDs": [ 12, 6, 5, 12, 5, 5, 11, 5, 4, 9 ], "topCandidateScores": [ -0.0685482993721962, -4.384251594543457, -4.661381721496582, -4.690056800842285, -5.3333539962768555, -5.336143493652344, -5.594904899597168, -5.668679714202881, -6.186341285705566, -6.922989845275879 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.0027894973754882812 }, { "step": 3, "inputTokenIDs": [ 12, 6, 5, 12, 5 ], "topCandidateParents": [ 0, 1, 3, 2, 0, 4, 0, 4, 0, 1 ], "topCandidateTokenIDs": [ 5, 11, 5, 7, 6, 6, 11, 5, 27, 12 ], "topCandidateScores": [ -0.07792448252439499, -4.431035995483398, -4.7164764404296875, -4.748763084411621, -5.423727989196777, -5.958462715148926, -5.978934288024902, -6.129289627075195, -7.826144695281982, -7.838249206542969 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.5347347259521484 }, { "step": 4, "inputTokenIDs": [ 5, 11, 5, 7, 6 ], "topCandidateParents": [ 0, 1, 3, 2, 4, 2, 3, 0, 0, 0 ], "topCandidateTokenIDs": [ 6, 9, 12, 6, 5, 5, 6, 5, 4, 11 ], "topCandidateScores": [ -0.07931052148342133, -4.431504249572754, -4.987690448760986, -5.136021137237549, -5.466120719909668, -5.792141914367676, -6.324781894683838, -7.0162858963012695, -8.780284881591797, -9.423460006713867 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.3260211944580078 }, { "step": 5, "inputTokenIDs": [ 6, 9, 12, 6, 5 ], "topCandidateParents": [ 0, 0, 1, 2, 4, 3, 3, 4, 0, 4 ], "topCandidateTokenIDs": [ 5, 11, 7, 5, 6, 11, 5, 5, 12, 7 ], "topCandidateScores": [ -0.15623527765274048, -2.6869289875030518, -4.431504249572754, -4.99858283996582, -5.777212142944336, -5.793299198150635, -5.868018627166748, -7.076404094696045, -8.512016296386719, -8.618317604064941 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.016087055206298828 }, { "step": 6, "inputTokenIDs": [ 5, 11, 7, 5, 6 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 0, 0, 4, 0, 2 ], "topCandidateTokenIDs": [ 7, 9, 12, 6, 5, 17, 5, 11, 23, 5 ], "topCandidateScores": [ -0.15677347779273987, -2.6879076957702637, -4.439654350280762, -4.999465465545654, -5.814878940582275, -8.922333717346191, -9.046469688415527, -9.189123153686523, -9.36185359954834, -9.84422492980957 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 3.107454776763916 }, { "step": 7, "inputTokenIDs": [ 7, 9, 12, 6, 5 ], "topCandidateParents": [ 0, 1, 2, 3, 3, 4, 2, 0, 0, 0 ], "topCandidateTokenIDs": [ 11, 7, 5, 11, 5, 7, 6, 6, 5, 9 ], "topCandidateScores": [ -0.15737304091453552, -2.6879076957702637, -4.470465660095215, -5.626060485839844, -5.765711784362793, -5.815248966217041, -8.149235725402832, -8.316309928894043, -9.178237915039062, -9.178729057312012 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.04953718185424805 }, { "step": 8, "inputTokenIDs": [ 11, 7, 5, 11, 5 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 2, 1, 1, 1, 0 ], "topCandidateTokenIDs": [ 9, 5, 5, 9, 7, 6, 4, 9, 27, 21 ], "topCandidateScores": [ -0.15758651494979858, -2.700490951538086, -4.541248798370361, -5.626638889312744, -5.769392967224121, -7.403156280517578, -7.67531681060791, -8.67983341217041, -8.867799758911133, -8.91384506225586 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 1.633763313293457 }, { "step": 9, "inputTokenIDs": [ 9, 5, 5, 9, 7 ], "topCandidateParents": [ 0, 1, 1, 2, 1, 1, 1, 3, 4, 1 ], "topCandidateTokenIDs": [ 3, 3, 17, 3, 5, 6, 23, 7, 11, 4 ], "topCandidateScores": [ -0.15758651494979858, -3.8236870765686035, -3.866804599761963, -4.63646125793457, -4.782362461090088, -5.211986064910889, -5.513620376586914, -5.626638889312744, -5.7697224617004395, -6.239506244659424 ], "activeCandidateIndices": [ 5, 6, 2, 7, 4 ], "finished": [ { "tokenIDs": [ 5, 5, 12, 5, 6, 5, 7, 11, 9 ], "score": -0.15758651494979858, "finishedAt": 9, "endedWithEOS": true }, { "tokenIDs": [ 5, 5, 12, 5, 6, 11, 9, 7, 5 ], "score": -3.8236870765686035, "finishedAt": 9, "endedWithEOS": true }, { "tokenIDs": [ 5, 5, 6, 11, 9, 7, 12, 5, 5 ], "score": -4.63646125793457, "finishedAt": 9, "endedWithEOS": true } ], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.4296236038208008 }, { "step": 10, "inputTokenIDs": [ 6, 23, 17, 7, 5 ], "topCandidateParents": [ 2, 4, 1, 3, 0, 0, 4, 4, 0, 0 ], "topCandidateTokenIDs": [ 3, 3, 3, 5, 5, 14, 6, 5, 11, 17 ], "topCandidateScores": [ -3.866804599761963, -5.346241474151611, -5.513620376586914, -5.629177093505859, -6.010337829589844, -6.314635753631592, -6.466061592102051, -6.651071071624756, -7.5329108238220215, -7.871143341064453 ], "activeCandidateIndices": [ 5, 6, 7, 3, 4 ], "finished": [ { "tokenIDs": [ 5, 5, 12, 5, 6, 11, 9, 7, 5, 17 ], "score": -3.866804599761963, "finishedAt": 10, "endedWithEOS": true }, { "tokenIDs": [ 5, 5, 12, 5, 6, 11, 9, 7, 5, 5 ], "score": -5.346241474151611, "finishedAt": 10, "endedWithEOS": true }, { "tokenIDs": [ 5, 5, 12, 5, 6, 11, 9, 7, 5, 23 ], "score": -5.513620376586914, "finishedAt": 10, "endedWithEOS": true } ], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.30429792404174805 } ], "compute_seconds": 0.0775, "runtime_evidence": { "ortWasmLinearMemoryBytes": 290717696, "rdkitWasmLinearMemoryBytes": 16777216, "gpuProfileEvents": 0, "gpuKernelTypes": [], "gpuMemoryBytes": null, "gpuQueueSubmissions": 0, "gpuComputePipelines": 0, "gpuDeviceLost": null, "peakResidentBytes": null, "cpuSeconds": null, "physicalDevicePerformance": false }, "kind": "prediction", "method": "ASKCOS Augmented Transformer · Pistachio 23Q3", "source_url": "https://github.com/ASKCOS/augmented_transformer", "precision": "FP32", "execution_target": "browser", "scope": "Predicted candidates; reaction conditions and experimental yield are not modeled." } }, { "id": "acyl-secondary-amine", "status": "passed", "networkBytes": 0, "receipt": { "identity": { "taskId": "candidate-prediction:9702ca2b-0e1a-4720-9915-71b28c3c3bd8", "attemptId": "attempt:4ba243e0-a963-427d-a876-816adbe6aac2", "generation": 1 }, "taskType": "reaction.product-prediction", "scientificProfileDigest": "72a1584ff8787ad3e0ed91021c054ef4b8869cdd79082c08f3f0561371240177", "implementationDigest": "9ba10bb450b9fc412dfc6acdcf2d8761fe6507645cc3265484b791dcde8622fa", "qualificationId": "prediction-fp32-q3-v2-product-v1", "normalizedInputHash": "9088da87ea9605312358c4d39df261e1f8b2f5516ea04187f9bf95744f8b96f2", "device": { "id": "candidate-prediction", "target": "browser", "class": "desktop", "connection": "online", "protocolVersion": 1, "implementationDigests": [ "9ba10bb450b9fc412dfc6acdcf2d8761fe6507645cc3265484b791dcde8622fa" ] }, "sourceReceipts": [ { "kind": "runtime", "build": "rolldown-1.0.3:sha256:db763a3d22d5a2b4c47dceca233f1d6bab58d76ab1e8a2302371f3c591cdf842", "concurrency": 1, "variant": "serial", "memoryBudgetBytes": 1610612736 } ], "parentResults": [], "startedAt": "2026-10-10T00:20:06.767Z", "endedAt": "2026-10-10T00:20:06.867Z", "wallSeconds": 0.1, "cpuSeconds": null, "peakResidentBytes": null, "quality": "complete", "warnings": [] }, "payload": { "reactants": "CC(=O)Cl.CNC", "candidates": [ { "smiles": "CC(=O)N(C)C", "formula": "C4H9NO", "model_score": -0.17848294973373413, "rank": 1 }, { "smiles": "CN(C)C(=O)CCl", "formula": "C4H8ClNO", "model_score": -3.825946807861328, "rank": 2 } ], "rejected_candidates": 0, "unknown_tokens": [], "conditions_modeled": false, "unspecified_stereo_candidates": [], "decoder_steps": 14, "hypotheses": [ { "tokenIDs": [ 5, 5, 6, 11, 9, 7, 12, 6, 5, 7, 5 ], "score": -0.17848294973373413, "finishedAt": 11, "endedWithEOS": true }, { "tokenIDs": [ 5, 12, 6, 5, 7, 5, 6, 11, 9, 7, 5, 17 ], "score": -3.825946807861328, "finishedAt": 12, "endedWithEOS": true }, { "tokenIDs": [ 5, 12, 6, 5, 7, 5, 6, 5, 7, 11, 9 ], "score": -3.9836809635162354, "finishedAt": 11, "endedWithEOS": true }, { "tokenIDs": [ 5, 6, 12, 6, 5, 7, 5, 7, 6, 11, 9, 7, 5 ], "score": -5.269954681396484, "finishedAt": 13, "endedWithEOS": true }, { "tokenIDs": [ 5, 6, 11, 9, 7, 6, 12, 6, 5, 7, 5, 7, 5 ], "score": -5.325537204742432, "finishedAt": 13, "endedWithEOS": true } ], "trace": [ { "step": 0, "inputTokenIDs": [ 2 ], "topCandidateParents": [ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ], "topCandidateTokenIDs": [ 5, 12, 4, 9, 17, 45, 13, 20, 23, 19 ], "topCandidateScores": [ -0.028483577072620392, -4.733840465545654, -4.7590837478637695, -5.003849029541016, -6.290844917297363, -7.387371063232422, -8.02721118927002, -8.993814468383789, -9.136407852172852, -9.213529586791992 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 1.0965261459350586 }, { "step": 1, "inputTokenIDs": [ 5, 12, 4, 9, 17 ], "topCandidateParents": [ 0, 0, 0, 2, 0, 1, 0, 3, 0, 4 ], "topCandidateTokenIDs": [ 5, 12, 6, 8, 9, 6, 11, 11, 8, 5 ], "topCandidateScores": [ -0.1443915218114853, -2.860485553741455, -3.509706497192383, -4.759084224700928, -4.787760257720947, -4.887517929077148, -5.123596668243408, -5.147469520568848, -5.884830951690674, -6.612764358520508 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.09975767135620117 }, { "step": 2, "inputTokenIDs": [ 5, 12, 6, 8, 9 ], "topCandidateParents": [ 0, 1, 2, 2, 2, 4, 3, 0, 0, 3 ], "topCandidateTokenIDs": [ 6, 6, 12, 11, 5, 5, 4, 5, 12, 6 ], "topCandidateScores": [ -0.15584959089756012, -2.877631425857544, -4.578916072845459, -4.623724937438965, -4.731060981750488, -5.002491474151611, -5.2425713539123535, -5.3934855461120605, -5.671815395355225, -6.026165008544922 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.27143049240112305 }, { "step": 3, "inputTokenIDs": [ 6, 6, 12, 11, 5 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 4, 0, 0, 4, 0 ], "topCandidateTokenIDs": [ 11, 5, 6, 9, 7, 6, 5, 12, 5, 9 ], "topCandidateScores": [ -0.15929926931858063, -2.8783388137817383, -4.594533920288086, -4.62903356552124, -5.068737030029297, -6.403765678405762, -6.568047046661377, -6.919166088104248, -7.784400939941406, -8.059612274169922 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 1.3350286483764648 }, { "step": 4, "inputTokenIDs": [ 11, 5, 6, 9, 7 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 1, 0, 4, 4, 0 ], "topCandidateTokenIDs": [ 9, 7, 5, 7, 6, 6, 21, 5, 12, 5 ], "topCandidateScores": [ -0.1595202535390854, -2.8959097862243652, -4.594858646392822, -4.62903356552124, -5.087760925292969, -6.977097034454346, -9.014214515686035, -9.8987455368042, -9.97651481628418, -10.020743370056152 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 1.889336109161377 }, { "step": 5, "inputTokenIDs": [ 9, 7, 5, 7, 6 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 4, 1, 4, 2, 1 ], "topCandidateTokenIDs": [ 7, 5, 7, 6, 11, 12, 4, 5, 6, 9 ], "topCandidateScores": [ -0.1595202535390854, -2.9029617309570312, -4.604638576507568, -4.6345672607421875, -5.760234355926514, -5.841160297393799, -8.439891815185547, -9.3143949508667, -9.512910842895508, -10.12281608581543 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.08092594146728516 }, { "step": 6, "inputTokenIDs": [ 7, 5, 7, 6, 11 ], "topCandidateParents": [ 0, 1, 2, 0, 3, 3, 0, 4, 0, 0 ], "topCandidateTokenIDs": [ 12, 6, 5, 5, 12, 5, 9, 9, 4, 17 ], "topCandidateScores": [ -0.1740136742591858, -2.9083147048950195, -4.6047749519348145, -5.033797264099121, -5.307293891906738, -5.37340784072876, -5.669943809509277, -5.760796070098877, -6.735407829284668, -7.242443561553955 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.06611394882202148 }, { "step": 7, "inputTokenIDs": [ 12, 6, 5, 5, 12 ], "topCandidateParents": [ 0, 1, 1, 2, 4, 3, 0, 3, 3, 0 ], "topCandidateTokenIDs": [ 6, 11, 5, 7, 6, 12, 5, 6, 5, 8 ], "topCandidateScores": [ -0.17708134651184082, -3.3382153511047363, -3.9657421112060547, -4.608747959136963, -5.3165082931518555, -5.730741024017334, -6.319183826446533, -6.343855381011963, -6.959341049194336, -8.124595642089844 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.4142327308654785 }, { "step": 8, "inputTokenIDs": [ 6, 11, 5, 7, 6 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 2, 0, 2, 2, 3 ], "topCandidateTokenIDs": [ 5, 9, 7, 6, 5, 17, 4, 23, 11, 5 ], "topCandidateScores": [ -0.17714595794677734, -3.338714122772217, -3.976090431213379, -4.611238479614258, -5.316592216491699, -9.246294975280762, -10.15462589263916, -10.403461456298828, -10.658442497253418, -11.243417739868164 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 3.9297027587890625 }, { "step": 9, "inputTokenIDs": [ 5, 9, 7, 6, 5 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 3, 0, 2, 0, 2 ], "topCandidateTokenIDs": [ 7, 7, 11, 11, 7, 5, 5, 6, 6, 5 ], "topCandidateScores": [ -0.17735527455806732, -3.338714122772217, -3.983320474624634, -5.251072406768799, -5.316972255706787, -5.365710258483887, -8.958596229553223, -9.085746765136719, -10.939404487609863, -11.480579376220703 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.04873800277709961 }, { "step": 10, "inputTokenIDs": [ 7, 7, 11, 11, 7 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 1, 1, 1, 0, 0 ], "topCandidateTokenIDs": [ 5, 5, 9, 9, 5, 4, 9, 27, 4, 9 ], "topCandidateScores": [ -0.17762620747089386, -3.363893508911133, -3.9836809635162354, -5.251894474029541, -5.317017555236816, -7.578614234924316, -8.710169792175293, -9.254409790039062, -9.352056503295898, -9.55524730682373 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 2.2615966796875 }, { "step": 11, "inputTokenIDs": [ 5, 5, 9, 9, 5 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 1, 1, 1, 1, 1 ], "topCandidateTokenIDs": [ 3, 17, 3, 7, 7, 5, 6, 23, 11, 4 ], "topCandidateScores": [ -0.17848294973373413, -3.825946807861328, -3.9836809635162354, -5.251894474029541, -5.317333698272705, -5.646965980529785, -6.188889503479004, -6.37500524520874, -6.518771171569824, -6.879871368408203 ], "activeCandidateIndices": [ 5, 1, 6, 3, 4 ], "finished": [ { "tokenIDs": [ 5, 5, 6, 11, 9, 7, 12, 6, 5, 7, 5 ], "score": -0.17848294973373413, "finishedAt": 11, "endedWithEOS": true }, { "tokenIDs": [ 5, 12, 6, 5, 7, 5, 6, 5, 7, 11, 9 ], "score": -3.9836809635162354, "finishedAt": 11, "endedWithEOS": true } ], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.3296322822570801 }, { "step": 12, "inputTokenIDs": [ 5, 17, 6, 7, 7 ], "topCandidateParents": [ 1, 3, 4, 0, 2, 0, 2, 2, 0, 0 ], "topCandidateTokenIDs": [ 3, 5, 5, 6, 5, 5, 14, 11, 24, 8 ], "topCandidateScores": [ -3.825946807861328, -5.254453659057617, -5.320303916931152, -6.672056674957275, -7.156406402587891, -7.192699909210205, -7.813163757324219, -7.854852199554443, -7.878252983093262, -8.173891067504883 ], "activeCandidateIndices": [ 5, 1, 2, 3, 4 ], "finished": [ { "tokenIDs": [ 5, 12, 6, 5, 7, 5, 6, 11, 9, 7, 5, 17 ], "score": -3.825946807861328, "finishedAt": 12, "endedWithEOS": true } ], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.03629350662231445 }, { "step": 13, "inputTokenIDs": [ 5, 5, 5, 6, 5 ], "topCandidateParents": [ 1, 2, 3, 4, 3, 0, 0, 0, 3, 0 ], "topCandidateTokenIDs": [ 3, 3, 11, 7, 5, 5, 17, 6, 12, 11 ], "topCandidateScores": [ -5.269954681396484, -5.325537204742432, -7.078240871429443, -7.194638252258301, -7.993840217590332, -8.211204528808594, -8.72679328918457, -8.98544692993164, -10.026987075805664, -10.116756439208984 ], "activeCandidateIndices": [ 5, 6, 2, 3, 4 ], "finished": [ { "tokenIDs": [ 5, 6, 12, 6, 5, 7, 5, 7, 6, 11, 9, 7, 5 ], "score": -5.269954681396484, "finishedAt": 13, "endedWithEOS": true }, { "tokenIDs": [ 5, 6, 11, 9, 7, 6, 12, 6, 5, 7, 5, 7, 5 ], "score": -5.325537204742432, "finishedAt": 13, "endedWithEOS": true } ], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.21736431121826172 } ], "compute_seconds": 0.09459999996423721, "runtime_evidence": { "ortWasmLinearMemoryBytes": 290717696, "rdkitWasmLinearMemoryBytes": 16777216, "gpuProfileEvents": 0, "gpuKernelTypes": [], "gpuMemoryBytes": null, "gpuQueueSubmissions": 0, "gpuComputePipelines": 0, "gpuDeviceLost": null, "peakResidentBytes": null, "cpuSeconds": null, "physicalDevicePerformance": false }, "kind": "prediction", "method": "ASKCOS Augmented Transformer · Pistachio 23Q3", "source_url": "https://github.com/ASKCOS/augmented_transformer", "precision": "FP32", "execution_target": "browser", "scope": "Predicted candidates; reaction conditions and experimental yield are not modeled." } }, { "id": "benzoyl-aniline", "status": "passed", "networkBytes": 0, "receipt": { "identity": { "taskId": "candidate-prediction:206f8a3d-a86a-4c45-b418-247e28cf47da", "attemptId": "attempt:fdc07a82-ca52-4f21-acb8-f01165078b1a", "generation": 1 }, "taskType": "reaction.product-prediction", "scientificProfileDigest": "72a1584ff8787ad3e0ed91021c054ef4b8869cdd79082c08f3f0561371240177", "implementationDigest": "9ba10bb450b9fc412dfc6acdcf2d8761fe6507645cc3265484b791dcde8622fa", "qualificationId": "prediction-fp32-q3-v2-product-v1", "normalizedInputHash": "aa7b125de2246f8d633992de2923528c455e663b833b58a55e502ec92bf63102", "device": { "id": "candidate-prediction", "target": "browser", "class": "desktop", "connection": "online", "protocolVersion": 1, "implementationDigests": [ "9ba10bb450b9fc412dfc6acdcf2d8761fe6507645cc3265484b791dcde8622fa" ] }, "sourceReceipts": [ { "kind": "runtime", "build": "rolldown-1.0.3:sha256:db763a3d22d5a2b4c47dceca233f1d6bab58d76ab1e8a2302371f3c591cdf842", "concurrency": 1, "variant": "serial", "memoryBudgetBytes": 1610612736 } ], "parentResults": [], "startedAt": "2026-10-10T00:20:06.937Z", "endedAt": "2026-10-10T00:20:07.113Z", "wallSeconds": 0.176, "cpuSeconds": null, "peakResidentBytes": null, "quality": "complete", "warnings": [] }, "payload": { "reactants": "Nc1ccccc1.O=C(Cl)c1ccccc1", "candidates": [ { "smiles": "O=C(Nc1ccccc1)c1ccccc1", "formula": "C13H11NO", "model_score": -0.250462144613266, "rank": 1 }, { "smiles": "c1ccc(CNc2ccccc2)cc1", "formula": "C13H13N", "model_score": -4.019680976867676, "rank": 2 }, { "smiles": "NC(=O)c1ccccc1", "formula": "C7H7NO", "model_score": -4.128462791442871, "rank": 3 }, { "smiles": "NC(=O)c1ccccc1-c1ccccc1", "formula": "C13H11NO", "model_score": -4.709738254547119, "rank": 4 } ], "rejected_candidates": 0, "unknown_tokens": [], "conditions_modeled": false, "unspecified_stereo_candidates": [], "decoder_steps": 24, "hypotheses": [ { "tokenIDs": [ 9, 11, 5, 6, 12, 4, 8, 4, 4, 4, 4, 4, 8, 7, 4, 8, 4, 4, 4, 4, 4, 8 ], "score": -0.250462144613266, "finishedAt": 22, "endedWithEOS": true }, { "tokenIDs": [ 4, 8, 4, 4, 4, 6, 5, 12, 4, 10, 4, 4, 4, 4, 4, 10, 7, 4, 4, 8 ], "score": -4.019680976867676, "finishedAt": 20, "endedWithEOS": true }, { "tokenIDs": [ 12, 5, 6, 11, 9, 7, 4, 8, 4, 4, 4, 4, 4, 8 ], "score": -4.128462791442871, "finishedAt": 14, "endedWithEOS": true }, { "tokenIDs": [ 12, 5, 6, 11, 9, 7, 4, 8, 4, 4, 4, 4, 4, 8, 18, 4, 8, 4, 4, 4, 4, 4, 8 ], "score": -4.709738254547119, "finishedAt": 23, "endedWithEOS": true }, { "tokenIDs": [ 4, 8, 4, 4, 4, 6, 12, 5, 4, 10, 4, 4, 4, 4, 4, 10, 7, 4, 4, 8 ], "score": -4.870745658874512, "finishedAt": 20, "endedWithEOS": true } ], "trace": [ { "step": 0, "inputTokenIDs": [ 2 ], "topCandidateParents": [ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ], "topCandidateTokenIDs": [ 9, 4, 12, 5, 17, 21, 13, 45, 23, 14 ], "topCandidateScores": [ -0.2076268047094345, -2.5957908630371094, -2.721048593521118, -3.2041015625, -5.244740009307861, -8.081330299377441, -8.208925247192383, -9.126276969909668, -9.44094467163086, -9.479694366455078 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 2.83659029006958 }, { "step": 1, "inputTokenIDs": [ 9, 4, 12, 5, 17 ], "topCandidateParents": [ 0, 1, 2, 2, 3, 3, 3, 3, 3, 4 ], "topCandidateTokenIDs": [ 11, 8, 4, 5, 5, 4, 6, 12, 9, 5 ], "topCandidateScores": [ -0.20974351465702057, -2.5957913398742676, -3.4372236728668213, -3.4759273529052734, -3.95290207862854, -5.124438285827637, -5.501314163208008, -5.5108866691589355, -5.589990615844727, -5.832111358642578 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 1.1715362071990967 }, { "step": 2, "inputTokenIDs": [ 11, 8, 4, 5, 5 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 4, 1, 0, 4, 4 ], "topCandidateTokenIDs": [ 5, 4, 8, 6, 6, 5, 6, 4, 9, 8 ], "topCandidateScores": [ -0.21503916382789612, -2.6697657108306885, -3.4372236728668213, -3.5208580493927, -4.925081729888916, -4.95731782913208, -5.285080909729004, -5.565704345703125, -6.529279708862305, -6.632394790649414 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.03223609924316406 }, { "step": 3, "inputTokenIDs": [ 5, 4, 8, 6, 6 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 1, 4, 0, 0, 0 ], "topCandidateTokenIDs": [ 6, 4, 4, 11, 5, 6, 11, 8, 4, 12 ], "topCandidateScores": [ -0.21950975060462952, -2.716837167739868, -3.4381508827209473, -3.523524284362793, -5.562820911407471, -5.8219404220581055, -5.943841457366943, -6.445130348205566, -7.293060302734375, -7.4064812660217285 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.25911951065063477 }, { "step": 4, "inputTokenIDs": [ 6, 4, 4, 11, 5 ], "topCandidateParents": [ 0, 1, 2, 3, 0, 4, 1, 2, 0, 0 ], "topCandidateTokenIDs": [ 12, 4, 4, 9, 4, 7, 6, 6, 9, 5 ], "topCandidateScores": [ -0.2328593134880066, -2.759394884109497, -3.5178651809692383, -3.525057554244995, -5.115196228027344, -5.626582145690918, -5.996386528015137, -6.011391639709473, -6.291884422302246, -6.458410739898682 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.5113859176635742 }, { "step": 5, "inputTokenIDs": [ 12, 4, 4, 9, 4 ], "topCandidateParents": [ 0, 1, 3, 2, 4, 1, 1, 0, 2, 0 ], "topCandidateTokenIDs": [ 4, 6, 7, 4, 8, 10, 4, 5, 6, 9 ], "topCandidateScores": [ -0.2369418740272522, -2.9030284881591797, -3.525071859359741, -3.5311086177825928, -5.115196228027344, -5.439731597900391, -5.490655422210693, -5.940397262573242, -7.933950424194336, -8.532922744750977 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.3245353698730469 }, { "step": 6, "inputTokenIDs": [ 4, 6, 7, 4, 8 ], "topCandidateParents": [ 0, 1, 2, 3, 1, 3, 4, 1, 1, 2 ], "topCandidateTokenIDs": [ 8, 5, 4, 6, 12, 4, 4, 18, 4, 5 ], "topCandidateScores": [ -0.2369418740272522, -3.462832450866699, -3.5706300735473633, -4.142088890075684, -4.1950860023498535, -4.332354545593262, -5.115220546722412, -5.164576530456543, -6.041141033172607, -6.7843523025512695 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.1372685432434082 }, { "step": 7, "inputTokenIDs": [ 8, 5, 4, 6, 12 ], "topCandidateParents": [ 0, 2, 1, 3, 4, 1, 4, 1, 1, 1 ], "topCandidateTokenIDs": [ 4, 8, 12, 5, 5, 6, 4, 10, 4, 5 ], "topCandidateScores": [ -0.23695486783981323, -3.5706307888031006, -3.953186511993408, -4.192598342895508, -4.681230068206787, -4.985860824584961, -5.426433563232422, -6.294596195220947, -6.332925796508789, -6.692394256591797 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.30463075637817383 }, { "step": 8, "inputTokenIDs": [ 4, 8, 12, 5, 5 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 4, 2, 3, 4, 2 ], "topCandidateTokenIDs": [ 4, 4, 4, 6, 4, 6, 5, 4, 10, 6 ], "topCandidateScores": [ -0.2371228188276291, -3.5708227157592773, -4.014273643493652, -4.220613956451416, -4.8536834716796875, -6.886516094207764, -7.354709148406982, -8.109174728393555, -8.419038772583008, -8.514023780822754 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 2.032832622528076 }, { "step": 9, "inputTokenIDs": [ 4, 4, 4, 6, 4 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 1, 0, 0, 3, 3 ], "topCandidateTokenIDs": [ 4, 4, 10, 11, 10, 6, 6, 13, 4, 9 ], "topCandidateScores": [ -0.2373162806034088, -3.5916800498962402, -4.014273643493652, -4.222705364227295, -4.8536834716796875, -7.462899684906006, -9.191869735717773, -10.193644523620605, -10.808128356933594, -11.745681762695312 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 2.6092162132263184 }, { "step": 10, "inputTokenIDs": [ 4, 4, 10, 11, 10 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 0, 1, 0, 0, 1 ], "topCandidateTokenIDs": [ 4, 4, 4, 9, 4, 6, 6, 10, 13, 10 ], "topCandidateScores": [ -0.2428777515888214, -3.5987350940704346, -4.014387607574463, -4.222771167755127, -4.853759765625, -5.456111431121826, -8.630304336547852, -9.67949390411377, -10.346073150634766, -11.642868041992188 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.6023516654968262 }, { "step": 11, "inputTokenIDs": [ 4, 4, 4, 9, 4 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 1, 0, 1, 0, 0 ], "topCandidateTokenIDs": [ 4, 4, 4, 7, 4, 6, 6, 10, 13, 10 ], "topCandidateScores": [ -0.24388718605041504, -3.6384761333465576, -4.014703273773193, -4.222771167755127, -4.854049205780029, -6.906122207641602, -7.230100631713867, -9.71599292755127, -10.037190437316895, -10.745931625366211 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 2.0520730018615723 }, { "step": 12, "inputTokenIDs": [ 4, 4, 4, 7, 4 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 1, 3, 1, 4, 3 ], "topCandidateTokenIDs": [ 8, 4, 4, 4, 4, 6, 5, 10, 13, 12 ], "topCandidateScores": [ -0.24388718605041504, -3.6638851165771484, -4.01518440246582, -4.22637939453125, -4.855702877044678, -7.377504348754883, -10.11215591430664, -10.331387519836426, -12.143965721130371, -12.189923286437988 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 2.521801471710205 }, { "step": 13, "inputTokenIDs": [ 8, 4, 4, 4, 4 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 0, 0, 0, 0, 4 ], "topCandidateTokenIDs": [ 7, 8, 4, 10, 4, 5, 28, 17, 9, 15 ], "topCandidateScores": [ -0.24454785883426666, -3.6638853549957275, -4.017662525177002, -4.22637939453125, -4.86791467666626, -8.852449417114258, -9.083609580993652, -9.354891777038574, -9.439848899841309, -9.738484382629395 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 3.984534740447998 }, { "step": 14, "inputTokenIDs": [ 7, 8, 4, 10, 4 ], "topCandidateParents": [ 0, 2, 1, 3, 1, 4, 0, 1, 0, 0 ], "topCandidateTokenIDs": [ 4, 4, 3, 4, 18, 4, 5, 5, 12, 9 ], "topCandidateScores": [ -0.24611018598079681, -4.018658638000488, -4.128462791442871, -4.226388931274414, -4.704233169555664, -4.869991779327393, -6.982296466827393, -7.8533172607421875, -8.423047065734863, -9.9369478225708 ], "activeCandidateIndices": [ 0, 1, 5, 3, 4 ], "finished": [ { "tokenIDs": [ 12, 5, 6, 11, 9, 7, 4, 8, 4, 4, 4, 4, 4, 8 ], "score": -4.128462791442871, "finishedAt": 14, "endedWithEOS": true } ], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.16575860977172852 }, { "step": 15, "inputTokenIDs": [ 4, 4, 4, 4, 18 ], "topCandidateParents": [ 0, 1, 3, 4, 2, 3, 4, 3, 3, 3 ], "topCandidateTokenIDs": [ 8, 10, 4, 4, 10, 6, 13, 13, 29, 15 ], "topCandidateScores": [ -0.24611018598079681, -4.018658638000488, -4.226500988006592, -4.704240798950195, -4.869991779327393, -13.377006530761719, -16.588916778564453, -16.988876342773438, -18.030460357666016, -18.258926391601562 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 8.507015228271484 }, { "step": 16, "inputTokenIDs": [ 8, 10, 4, 4, 10 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 0, 1, 1, 1, 1 ], "topCandidateTokenIDs": [ 4, 7, 4, 8, 7, 13, 5, 17, 18, 9 ], "topCandidateScores": [ -0.24612925946712494, -4.019604682922363, -4.226576805114746, -4.704240798950195, -4.870481014251709, -11.40740966796875, -11.920843124389648, -12.680489540100098, -12.865554809570312, -13.246943473815918 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 6.536928653717041 }, { "step": 17, "inputTokenIDs": [ 4, 7, 4, 8, 7 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 0, 2, 0, 0, 0 ], "topCandidateTokenIDs": [ 4, 4, 4, 4, 4, 6, 6, 13, 10, 25 ], "topCandidateScores": [ -0.24624763429164886, -4.019619941711426, -4.229904651641846, -4.704256534576416, -4.870534896850586, -9.544322967529297, -9.948509216308594, -11.162282943725586, -12.664361000061035, -13.107271194458008 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 4.673788070678711 }, { "step": 18, "inputTokenIDs": [ 4, 4, 4, 4, 4 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 0, 0, 2, 0, 0 ], "topCandidateTokenIDs": [ 4, 4, 4, 4, 4, 6, 13, 6, 10, 29 ], "topCandidateScores": [ -0.246397465467453, -4.019671440124512, -4.231052398681641, -4.7046098709106445, -4.87071418762207, -9.860239028930664, -9.903897285461426, -11.025588989257812, -12.194177627563477, -12.227402687072754 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 4.989524841308594 }, { "step": 19, "inputTokenIDs": [ 4, 4, 4, 4, 4 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 0, 0, 0, 0, 0 ], "topCandidateTokenIDs": [ 4, 8, 10, 4, 8, 6, 13, 10, 29, 26 ], "topCandidateScores": [ -0.24858398735523224, -4.019671440124512, -4.231052398681641, -4.704864501953125, -4.87071418762207, -6.462053298950195, -9.687400817871094, -9.941357612609863, -10.804069519042969, -11.558653831481934 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 1.591339111328125 }, { "step": 20, "inputTokenIDs": [ 4, 8, 10, 4, 8 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 0, 2, 3, 0, 0 ], "topCandidateTokenIDs": [ 4, 3, 7, 4, 3, 6, 17, 6, 13, 10 ], "topCandidateScores": [ -0.2493286430835724, -4.019680976867676, -4.234617710113525, -4.708165645599365, -4.870745658874512, -7.518648147583008, -10.165407180786133, -10.443347930908203, -10.619965553283691, -11.290868759155273 ], "activeCandidateIndices": [ 0, 5, 2, 3, 6 ], "finished": [ { "tokenIDs": [ 4, 8, 4, 4, 4, 6, 5, 12, 4, 10, 4, 4, 4, 4, 4, 10, 7, 4, 4, 8 ], "score": -4.019680976867676, "finishedAt": 20, "endedWithEOS": true }, { "tokenIDs": [ 4, 8, 4, 4, 4, 6, 12, 5, 4, 10, 4, 4, 4, 4, 4, 10, 7, 4, 4, 8 ], "score": -4.870745658874512, "finishedAt": 20, "endedWithEOS": true } ], "exactTiesInTopCandidates": 0, "beamCutoffGap": 2.647902488708496 }, { "step": 21, "inputTokenIDs": [ 4, 6, 7, 4, 17 ], "topCandidateParents": [ 0, 2, 3, 1, 1, 1, 1, 1, 4, 1 ], "topCandidateTokenIDs": [ 8, 4, 4, 17, 9, 18, 5, 23, 7, 12 ], "topCandidateScores": [ -0.2493286430835724, -4.234631061553955, -4.7091193199157715, -8.50597095489502, -9.409317016601562, -9.463530540466309, -9.705316543579102, -9.915733337402344, -10.165407180786133, -10.590863227844238 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.054213523864746094 }, { "step": 22, "inputTokenIDs": [ 8, 4, 4, 17, 9 ], "topCandidateParents": [ 0, 1, 2, 0, 3, 1, 0, 0, 0, 0 ], "topCandidateTokenIDs": [ 3, 4, 8, 17, 7, 6, 9, 18, 23, 5 ], "topCandidateScores": [ -0.250462144613266, -4.243717193603516, -4.7091193199157715, -7.703772068023682, -8.50597095489502, -8.951000213623047, -8.95844554901123, -9.201489448547363, -9.395865440368652, -9.6149263381958 ], "activeCandidateIndices": [ 5, 1, 2, 3, 4 ], "finished": [ { "tokenIDs": [ 9, 11, 5, 6, 12, 4, 8, 4, 4, 4, 4, 4, 8, 7, 4, 8, 4, 4, 4, 4, 4, 8 ], "score": -0.250462144613266, "finishedAt": 22, "endedWithEOS": true } ], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.44502925872802734 }, { "step": 23, "inputTokenIDs": [ 6, 4, 8, 17, 7 ], "topCandidateParents": [ 1, 2, 3, 4, 0, 0, 0, 0, 0, 0 ], "topCandidateTokenIDs": [ 8, 3, 3, 4, 5, 17, 9, 21, 23, 14 ], "topCandidateScores": [ -4.243717193603516, -4.709738254547119, -7.703772068023682, -8.507647514343262, -10.035201072692871, -10.346455574035645, -10.728348731994629, -10.810945510864258, -12.757120132446289, -12.77219295501709 ], "activeCandidateIndices": [ 0, 5, 6, 3, 4 ], "finished": [ { "tokenIDs": [ 12, 5, 6, 11, 9, 7, 4, 8, 4, 4, 4, 4, 4, 8, 18, 4, 8, 4, 4, 4, 4, 4, 8 ], "score": -4.709738254547119, "finishedAt": 23, "endedWithEOS": true }, { "tokenIDs": [ 9, 11, 5, 6, 12, 4, 8, 4, 4, 4, 4, 4, 8, 7, 4, 8, 4, 4, 4, 4, 4, 8, 17 ], "score": -7.703772068023682, "finishedAt": 23, "endedWithEOS": true } ], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.31125450134277344 } ], "compute_seconds": 0.1705, "runtime_evidence": { "ortWasmLinearMemoryBytes": 290717696, "rdkitWasmLinearMemoryBytes": 16777216, "gpuProfileEvents": 0, "gpuKernelTypes": [], "gpuMemoryBytes": null, "gpuQueueSubmissions": 0, "gpuComputePipelines": 0, "gpuDeviceLost": null, "peakResidentBytes": null, "cpuSeconds": null, "physicalDevicePerformance": false }, "kind": "prediction", "method": "ASKCOS Augmented Transformer · Pistachio 23Q3", "source_url": "https://github.com/ASKCOS/augmented_transformer", "precision": "FP32", "execution_target": "browser", "scope": "Predicted candidates; reaction conditions and experimental yield are not modeled." } }, { "id": "acyl-alcohol", "status": "passed", "networkBytes": 0, "receipt": { "identity": { "taskId": "candidate-prediction:2d87b01f-ad22-440a-83de-5de019f668f5", "attemptId": "attempt:1f1e0927-7534-49bd-af45-a3efa55e509d", "generation": 1 }, "taskType": "reaction.product-prediction", "scientificProfileDigest": "72a1584ff8787ad3e0ed91021c054ef4b8869cdd79082c08f3f0561371240177", "implementationDigest": "9ba10bb450b9fc412dfc6acdcf2d8761fe6507645cc3265484b791dcde8622fa", "qualificationId": "prediction-fp32-q3-v2-product-v1", "normalizedInputHash": "73ec1309dc46f5f565f3c9271e6f75c61e97c843b0d7ceb664b1982ca10565c9", "device": { "id": "candidate-prediction", "target": "browser", "class": "desktop", "connection": "online", "protocolVersion": 1, "implementationDigests": [ "9ba10bb450b9fc412dfc6acdcf2d8761fe6507645cc3265484b791dcde8622fa" ] }, "sourceReceipts": [ { "kind": "runtime", "build": "rolldown-1.0.3:sha256:db763a3d22d5a2b4c47dceca233f1d6bab58d76ab1e8a2302371f3c591cdf842", "concurrency": 1, "variant": "serial", "memoryBudgetBytes": 1610612736 } ], "parentResults": [], "startedAt": "2026-10-10T00:20:07.172Z", "endedAt": "2026-10-10T00:20:07.271Z", "wallSeconds": 0.099, "cpuSeconds": null, "peakResidentBytes": null, "quality": "complete", "warnings": [] }, "payload": { "reactants": "CC(=O)Cl.CCO", "candidates": [ { "smiles": "CCOC(C)=O", "formula": "C4H8O2", "model_score": -0.6340926885604858, "rank": 1 }, { "smiles": "CCOC(=O)CCl", "formula": "C4H7ClO2", "model_score": -3.2449092864990234, "rank": 2 } ], "rejected_candidates": 2, "unknown_tokens": [], "conditions_modeled": false, "unspecified_stereo_candidates": [], "decoder_steps": 15, "hypotheses": [ { "tokenIDs": [ 5, 5, 9, 5, 6, 5, 7, 11, 9 ], "score": -0.6340926885604858, "finishedAt": 9, "endedWithEOS": true }, { "tokenIDs": [ 5, 5, 9, 5, 6, 11, 9, 7, 5, 17 ], "score": -3.2449092864990234, "finishedAt": 10, "endedWithEOS": true }, { "tokenIDs": [ 5, 5, 6, 11, 9, 7, 9, 5, 5 ], "score": -3.6784071922302246, "finishedAt": 9, "endedWithEOS": true }, { "tokenIDs": [ 5, 5, 9, 5, 6, 11, 9, 7, 5, 23 ], "score": -4.010412693023682, "finishedAt": 10, "endedWithEOS": true }, { "tokenIDs": [ 5, 5, 9, 5, 6, 11, 9, 7, 5, 6, 5, 7, 11, 9 ], "score": -5.1188154220581055, "finishedAt": 14, "endedWithEOS": true } ], "trace": [ { "step": 0, "inputTokenIDs": [ 2 ], "topCandidateParents": [ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ], "topCandidateTokenIDs": [ 5, 9, 4, 17, 12, 45, 39, 14, 20, 19 ], "topCandidateScores": [ -0.04706349968910217, -3.841247797012329, -4.554443836212158, -5.006059169769287, -5.827505588531494, -7.50092077255249, -7.8441548347473145, -7.898693561553955, -8.096343994140625, -8.171550750732422 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 1.673415184020996 }, { "step": 1, "inputTokenIDs": [ 5, 9, 4, 17, 12 ], "topCandidateParents": [ 0, 0, 0, 1, 2, 0, 1, 0, 3, 0 ], "topCandidateTokenIDs": [ 5, 6, 11, 11, 8, 9, 6, 4, 5, 8 ], "topCandidateScores": [ -0.10062693059444427, -4.143123626708984, -4.24675178527832, -4.313085079193115, -4.554443836212158, -4.875626564025879, -5.231474876403809, -5.615930557250977, -5.645776748657227, -5.989497661590576 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.3211827278137207 }, { "step": 2, "inputTokenIDs": [ 5, 6, 11, 11, 8 ], "topCandidateParents": [ 0, 0, 2, 3, 0, 4, 1, 1, 4, 1 ], "topCandidateTokenIDs": [ 9, 6, 5, 5, 5, 4, 5, 9, 6, 11 ], "topCandidateScores": [ -0.18107861280441284, -2.8580548763275146, -4.247586250305176, -4.360499858856201, -4.818837642669678, -4.997284889221191, -5.0128350257873535, -5.160729885101318, -5.795227527618408, -5.907128810882568 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.17844724655151367 }, { "step": 3, "inputTokenIDs": [ 9, 6, 5, 5, 5 ], "topCandidateParents": [ 0, 1, 3, 2, 2, 4, 4, 0, 3, 2 ], "topCandidateTokenIDs": [ 5, 11, 6, 5, 6, 6, 5, 4, 8, 9 ], "topCandidateScores": [ -0.1866961568593979, -2.884939432144165, -4.510165691375732, -4.837645530700684, -5.492438793182373, -5.547915935516357, -5.908850193023682, -6.296444416046143, -6.747707366943359, -6.839205741882324 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.055477142333984375 }, { "step": 4, "inputTokenIDs": [ 5, 11, 6, 5, 6 ], "topCandidateParents": [ 0, 1, 2, 2, 3, 3, 3, 4, 4, 0 ], "topCandidateTokenIDs": [ 6, 9, 9, 5, 5, 6, 9, 9, 5, 5 ], "topCandidateScores": [ -0.1899520605802536, -2.885456085205078, -5.275923728942871, -5.496156215667725, -5.971296310424805, -6.118566036224365, -6.159270763397217, -6.259857654571533, -6.30132532119751, -6.604302406311035 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.14726972579956055 }, { "step": 5, "inputTokenIDs": [ 6, 9, 9, 5, 5 ], "topCandidateParents": [ 0, 0, 1, 2, 3, 2, 4, 4, 0, 0 ], "topCandidateTokenIDs": [ 5, 11, 7, 5, 7, 7, 5, 6, 9, 12 ], "topCandidateScores": [ -0.5978723168373108, -1.2907600402832031, -2.8854563236236572, -5.733851432800293, -5.868438720703125, -6.424032211303711, -6.652131080627441, -7.098077774047852, -7.12294864654541, -7.947081565856934 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.5555934906005859 }, { "step": 6, "inputTokenIDs": [ 5, 11, 7, 5, 7 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 2, 0, 0, 2, 2 ], "topCandidateTokenIDs": [ 7, 9, 9, 5, 9, 5, 17, 23, 4, 12 ], "topCandidateScores": [ -0.6033300757408142, -1.2920182943344116, -2.933166265487671, -5.821918964385986, -5.961780548095703, -6.753515720367432, -7.1017279624938965, -7.282996654510498, -7.314323425292969, -7.409557342529297 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.7917351722717285 }, { "step": 7, "inputTokenIDs": [ 7, 9, 9, 5, 9 ], "topCandidateParents": [ 0, 1, 2, 0, 0, 3, 4, 2, 0, 0 ], "topCandidateTokenIDs": [ 11, 7, 5, 6, 9, 7, 5, 4, 5, 17 ], "topCandidateScores": [ -0.6336356401443481, -1.2920184135437012, -2.9588937759399414, -4.513706684112549, -5.406335830688477, -5.832981109619141, -6.004260540008545, -7.025936126708984, -7.524884223937988, -8.762950897216797 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.42664527893066406 }, { "step": 8, "inputTokenIDs": [ 11, 7, 5, 6, 9 ], "topCandidateParents": [ 0, 1, 2, 1, 1, 3, 4, 2, 3, 1 ], "topCandidateTokenIDs": [ 9, 5, 5, 27, 4, 9, 5, 6, 5, 9 ], "topCandidateScores": [ -0.6340925693511963, -1.3975129127502441, -3.108159065246582, -4.307528495788574, -4.6103692054748535, -5.033791542053223, -5.4571146965026855, -5.517531871795654, -5.6749701499938965, -6.130395412445068 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.42342233657836914 }, { "step": 9, "inputTokenIDs": [ 9, 5, 5, 27, 4 ], "topCandidateParents": [ 0, 1, 1, 1, 2, 1, 3, 1, 4, 1 ], "topCandidateTokenIDs": [ 3, 5, 6, 17, 3, 23, 5, 3, 8, 4 ], "topCandidateScores": [ -0.6340926885604858, -2.4196414947509766, -3.230484962463379, -3.2449092864990234, -3.6784071922302246, -4.010411739349365, -4.307658672332764, -4.3669962882995605, -4.6103692054748535, -4.670894145965576 ], "activeCandidateIndices": [ 5, 1, 2, 3, 6 ], "finished": [ { "tokenIDs": [ 5, 5, 9, 5, 6, 5, 7, 11, 9 ], "score": -0.6340926885604858, "finishedAt": 9, "endedWithEOS": true }, { "tokenIDs": [ 5, 5, 6, 11, 9, 7, 9, 5, 5 ], "score": -3.6784071922302246, "finishedAt": 9, "endedWithEOS": true } ], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.3320045471191406 }, { "step": 10, "inputTokenIDs": [ 23, 5, 6, 17, 5 ], "topCandidateParents": [ 1, 3, 0, 2, 2, 4, 1, 1, 1, 2 ], "topCandidateTokenIDs": [ 6, 3, 3, 5, 11, 11, 5, 3, 11, 17 ], "topCandidateScores": [ -2.7719204425811768, -3.2449092864990234, -4.010412693023682, -4.0350165367126465, -4.186732292175293, -4.410348892211914, -4.634124755859375, -5.424999237060547, -5.684895038604736, -5.993190765380859 ], "activeCandidateIndices": [ 0, 5, 6, 3, 4 ], "finished": [ { "tokenIDs": [ 5, 5, 9, 5, 6, 11, 9, 7, 5, 17 ], "score": -3.2449092864990234, "finishedAt": 10, "endedWithEOS": true }, { "tokenIDs": [ 5, 5, 9, 5, 6, 11, 9, 7, 5, 23 ], "score": -4.010412693023682, "finishedAt": 10, "endedWithEOS": true } ], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.2236166000366211 }, { "step": 11, "inputTokenIDs": [ 6, 11, 5, 5, 11 ], "topCandidateParents": [ 0, 0, 3, 4, 1, 2, 2, 2, 2, 3 ], "topCandidateTokenIDs": [ 11, 5, 7, 9, 5, 5, 6, 17, 11, 5 ], "topCandidateScores": [ -3.2292652130126953, -3.8237431049346924, -4.169090747833252, -4.198641777038574, -4.410697937011719, -5.738679885864258, -6.178817272186279, -6.195396423339844, -6.8484206199646, -7.476289749145508 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 1.327981948852539 }, { "step": 12, "inputTokenIDs": [ 11, 5, 7, 9, 5 ], "topCandidateParents": [ 0, 1, 3, 4, 2, 2, 2, 4, 2, 2 ], "topCandidateTokenIDs": [ 9, 7, 7, 27, 11, 6, 5, 6, 9, 17 ], "topCandidateScores": [ -3.2305848598480225, -3.971409320831299, -4.198641777038574, -4.616767406463623, -5.111293315887451, -5.8544020652771, -5.92695426940918, -6.459498405456543, -6.4910101890563965, -6.609353065490723 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.7431087493896484 }, { "step": 13, "inputTokenIDs": [ 9, 7, 7, 27, 11 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 2, 2, 3, 2, 3 ], "topCandidateTokenIDs": [ 7, 11, 5, 5, 9, 9, 4, 4, 17, 9 ], "topCandidateScores": [ -3.2305848598480225, -4.04987096786499, -4.952692031860352, -5.108268737792969, -5.1188154220581055, -5.693790435791016, -5.917365074157715, -6.116324424743652, -6.679025173187256, -7.4397077560424805 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.5749750137329102 }, { "step": 14, "inputTokenIDs": [ 7, 11, 5, 5, 9 ], "topCandidateParents": [ 0, 1, 0, 4, 0, 3, 0, 2, 2, 2 ], "topCandidateTokenIDs": [ 5, 9, 9, 3, 4, 6, 17, 5, 17, 6 ], "topCandidateScores": [ -3.7036306858062744, -4.050586700439453, -5.038713455200195, -5.1188154220581055, -5.414512634277344, -5.556145668029785, -5.789170265197754, -6.136447429656982, -6.493110656738281, -6.537052154541016 ], "activeCandidateIndices": [ 0, 1, 2, 5, 4 ], "finished": [ { "tokenIDs": [ 5, 5, 9, 5, 6, 11, 9, 7, 5, 6, 5, 7, 11, 9 ], "score": -5.1188154220581055, "finishedAt": 14, "endedWithEOS": true } ], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.1416330337524414 } ], "compute_seconds": 0.095, "runtime_evidence": { "ortWasmLinearMemoryBytes": 290717696, "rdkitWasmLinearMemoryBytes": 16777216, "gpuProfileEvents": 0, "gpuKernelTypes": [], "gpuMemoryBytes": null, "gpuQueueSubmissions": 0, "gpuComputePipelines": 0, "gpuDeviceLost": null, "peakResidentBytes": null, "cpuSeconds": null, "physicalDevicePerformance": false }, "kind": "prediction", "method": "ASKCOS Augmented Transformer · Pistachio 23Q3", "source_url": "https://github.com/ASKCOS/augmented_transformer", "precision": "FP32", "execution_target": "browser", "scope": "Predicted candidates; reaction conditions and experimental yield are not modeled." } }, { "id": "boronic-heteroaryl", "status": "passed", "networkBytes": 0, "receipt": { "identity": { "taskId": "candidate-prediction:983a7ccf-9ab5-4cc0-a5fd-cc39036c00e2", "attemptId": "attempt:2eca025f-1c4f-45ae-9196-2a730c566dd5", "generation": 1 }, "taskType": "reaction.product-prediction", "scientificProfileDigest": "72a1584ff8787ad3e0ed91021c054ef4b8869cdd79082c08f3f0561371240177", "implementationDigest": "9ba10bb450b9fc412dfc6acdcf2d8761fe6507645cc3265484b791dcde8622fa", "qualificationId": "prediction-fp32-q3-v2-product-v1", "normalizedInputHash": "fb964821dd7724f5bc26f8f8f905bd3e0148fb52b3348efc81edf34f673890d0", "device": { "id": "candidate-prediction", "target": "browser", "class": "desktop", "connection": "online", "protocolVersion": 1, "implementationDigests": [ "9ba10bb450b9fc412dfc6acdcf2d8761fe6507645cc3265484b791dcde8622fa" ] }, "sourceReceipts": [ { "kind": "runtime", "build": "rolldown-1.0.3:sha256:db763a3d22d5a2b4c47dceca233f1d6bab58d76ab1e8a2302371f3c591cdf842", "concurrency": 1, "variant": "serial", "memoryBudgetBytes": 1610612736 } ], "parentResults": [], "startedAt": "2026-10-10T00:20:07.333Z", "endedAt": "2026-10-10T00:20:07.474Z", "wallSeconds": 0.141, "cpuSeconds": null, "peakResidentBytes": null, "quality": "complete", "warnings": [] }, "payload": { "reactants": "Brc1ccncc1.OB(O)c1ccccc1", "candidates": [ { "smiles": "c1ccc(-c2ccncc2)cc1", "formula": "C11H9N", "model_score": -0.04603665694594383, "rank": 1 }, { "smiles": "c1ccc(-c2cccnc2)cc1", "formula": "C11H9N", "model_score": -5.196565628051758, "rank": 2 }, { "smiles": "c1ccc(-c2ccccn2)cc1", "formula": "C11H9N", "model_score": -5.445723056793213, "rank": 3 }, { "smiles": "c1ccc(C2CCNCC2)cc1", "formula": "C11H15N", "model_score": -6.376388072967529, "rank": 4 }, { "smiles": "C1=CC(c2ccccc2)CCN1", "formula": "C11H13N", "model_score": -6.986639976501465, "rank": 5 } ], "rejected_candidates": 0, "unknown_tokens": [], "conditions_modeled": false, "unspecified_stereo_candidates": [], "decoder_steps": 20, "hypotheses": [ { "tokenIDs": [ 4, 8, 4, 4, 4, 6, 18, 4, 10, 4, 4, 13, 4, 4, 10, 7, 4, 4, 8 ], "score": -0.04603665694594383, "finishedAt": 19, "endedWithEOS": true }, { "tokenIDs": [ 4, 8, 4, 4, 4, 6, 18, 4, 10, 4, 4, 4, 13, 4, 10, 7, 4, 4, 8 ], "score": -5.196565628051758, "finishedAt": 19, "endedWithEOS": true }, { "tokenIDs": [ 4, 8, 4, 4, 4, 6, 18, 4, 10, 4, 4, 4, 4, 13, 10, 7, 4, 4, 8 ], "score": -5.445723056793213, "finishedAt": 19, "endedWithEOS": true }, { "tokenIDs": [ 4, 8, 4, 4, 4, 6, 5, 10, 5, 5, 12, 5, 5, 10, 7, 4, 4, 8 ], "score": -6.376388072967529, "finishedAt": 18, "endedWithEOS": true }, { "tokenIDs": [ 5, 8, 11, 5, 5, 6, 4, 10, 4, 4, 4, 4, 4, 10, 7, 5, 5, 12, 8 ], "score": -6.986639976501465, "finishedAt": 19, "endedWithEOS": true } ], "trace": [ { "step": 0, "inputTokenIDs": [ 2 ], "topCandidateParents": [ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ], "topCandidateTokenIDs": [ 4, 5, 23, 13, 12, 9, 17, 14, 18, 34 ], "topCandidateScores": [ -0.021267926320433617, -4.275734901428223, -5.892375469207764, -6.499810218811035, -6.526828765869141, -7.258628845214844, -8.091290473937988, -9.24698543548584, -9.317317962646484, -9.405661582946777 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.7318000793457031 }, { "step": 1, "inputTokenIDs": [ 4, 5, 23, 13, 12 ], "topCandidateParents": [ 0, 1, 1, 2, 1, 3, 1, 4, 4, 1 ], "topCandidateTokenIDs": [ 8, 8, 4, 4, 5, 8, 6, 4, 24, 12 ], "topCandidateScores": [ -0.021267926320433617, -5.043816566467285, -5.788340091705322, -5.8955583572387695, -6.017277240753174, -6.499810218811035, -7.1446428298950195, -7.19457483291626, -7.603304862976074, -7.6443634033203125 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.48253297805786133 }, { "step": 2, "inputTokenIDs": [ 8, 8, 4, 4, 5 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 0, 4, 4, 1, 4 ], "topCandidateTokenIDs": [ 4, 11, 8, 8, 6, 6, 5, 8, 5, 12 ], "topCandidateScores": [ -0.022066906094551086, -5.100423812866211, -5.788341045379639, -5.8955583572387695, -6.975424289703369, -7.431750774383545, -7.61345100402832, -7.6417951583862305, -8.115068435668945, -8.619415283203125 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.4563264846801758 }, { "step": 3, "inputTokenIDs": [ 4, 11, 8, 8, 6 ], "topCandidateParents": [ 0, 1, 3, 2, 4, 0, 2, 0, 4, 1 ], "topCandidateTokenIDs": [ 4, 5, 4, 4, 5, 13, 13, 6, 11, 12 ], "topCandidateScores": [ -0.02280966192483902, -5.114882469177246, -5.898882865905762, -5.940420627593994, -7.130134582519531, -7.6802592277526855, -7.7565484046936035, -8.300666809082031, -9.244867324829102, -9.360817909240723 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.5501246452331543 }, { "step": 4, "inputTokenIDs": [ 4, 5, 4, 4, 5 ], "topCandidateParents": [ 0, 1, 2, 3, 1, 4, 0, 1, 3, 0 ], "topCandidateTokenIDs": [ 4, 5, 4, 4, 6, 7, 6, 12, 13, 13 ], "topCandidateScores": [ -0.023673437535762787, -5.5317301750183105, -5.943132400512695, -6.16117000579834, -6.653463363647461, -7.147432327270508, -7.2528076171875, -7.300178050994873, -7.725704193115234, -9.029397964477539 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.4939689636230469 }, { "step": 5, "inputTokenIDs": [ 4, 5, 4, 4, 6 ], "topCandidateParents": [ 0, 1, 2, 4, 3, 2, 3, 1, 1, 2 ], "topCandidateTokenIDs": [ 6, 6, 13, 4, 4, 4, 6, 5, 11, 6 ], "topCandidateScores": [ -0.024151472374796867, -5.888179302215576, -6.568118095397949, -6.666845321655273, -6.822081565856934, -6.9930877685546875, -7.069160461425781, -7.465363502502441, -8.092961311340332, -8.192747116088867 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.1710062026977539 }, { "step": 6, "inputTokenIDs": [ 6, 6, 13, 4, 4 ], "topCandidateParents": [ 0, 0, 1, 2, 3, 0, 4, 4, 0, 0 ], "topCandidateTokenIDs": [ 18, 5, 4, 4, 10, 12, 4, 6, 33, 9 ], "topCandidateScores": [ -0.028389310464262962, -5.833794116973877, -5.926159381866455, -6.575436115264893, -6.666845321655273, -7.218478202819824, -7.497010707855225, -7.605144023895264, -8.536982536315918, -8.738383293151855 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.5516328811645508 }, { "step": 7, "inputTokenIDs": [ 18, 5, 4, 4, 10 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 0, 3, 1, 1, 1 ], "topCandidateTokenIDs": [ 4, 10, 10, 6, 4, 13, 4, 4, 5, 12 ], "topCandidateScores": [ -0.028824687004089355, -5.913374900817871, -5.926159381866455, -6.666893482208252, -6.668240070343018, -7.7753190994262695, -9.087872505187988, -9.208332061767578, -9.94920825958252, -10.4403715133667 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 1.107079029083252 }, { "step": 8, "inputTokenIDs": [ 4, 10, 10, 6, 4 ], "topCandidateParents": [ 0, 2, 1, 4, 3, 1, 1, 3, 1, 2 ], "topCandidateTokenIDs": [ 10, 4, 5, 4, 18, 11, 6, 5, 12, 13 ], "topCandidateScores": [ -0.028824687004089355, -5.926912784576416, -6.333360195159912, -6.6698689460754395, -6.670801162719727, -7.089573860168457, -9.332412719726562, -12.52261734008789, -12.839052200317383, -13.122607231140137 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.41877269744873047 }, { "step": 9, "inputTokenIDs": [ 10, 4, 5, 4, 18 ], "topCandidateParents": [ 0, 1, 2, 4, 3, 0, 3, 2, 1, 0 ], "topCandidateTokenIDs": [ 4, 4, 5, 4, 4, 13, 13, 11, 13, 5 ], "topCandidateScores": [ -0.030006663873791695, -5.927921295166016, -6.366568565368652, -6.670828819274902, -6.775697708129883, -6.77578592300415, -8.974589347839355, -9.812837600708008, -12.891111373901367, -13.210813522338867 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 8.821487426757812e-05 }, { "step": 10, "inputTokenIDs": [ 4, 4, 5, 4, 4 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 0, 1, 0, 0, 4 ], "topCandidateTokenIDs": [ 4, 4, 12, 10, 4, 13, 13, 6, 15, 13 ], "topCandidateScores": [ -0.03103681653738022, -5.957030296325684, -6.37028694152832, -6.670828819274902, -6.781445026397705, -7.038478851318359, -9.49068546295166, -9.627054214477539, -10.105125427246094, -12.427606582641602 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.2570338249206543 }, { "step": 11, "inputTokenIDs": [ 4, 4, 12, 10, 4 ], "topCandidateParents": [ 0, 0, 1, 2, 3, 4, 0, 0, 0, 0 ], "topCandidateTokenIDs": [ 13, 4, 4, 5, 4, 4, 6, 46, 15, 25 ], "topCandidateScores": [ -0.04422967880964279, -4.414546489715576, -5.961282253265381, -6.375486373901367, -6.670912265777588, -6.787884712219238, -7.7533721923828125, -9.224031448364258, -10.230518341064453, -10.360197067260742 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.11697244644165039 }, { "step": 12, "inputTokenIDs": [ 13, 4, 4, 5, 4 ], "topCandidateParents": [ 0, 1, 1, 2, 3, 4, 1, 1, 1, 0 ], "topCandidateTokenIDs": [ 4, 13, 4, 4, 5, 4, 15, 6, 25, 13 ], "topCandidateScores": [ -0.04425042122602463, -5.188958168029785, -5.266273498535156, -5.965338706970215, -6.375953197479248, -6.671053409576416, -7.312460899353027, -7.324040412902832, -11.122919082641602, -11.324872016906738 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.29510021209716797 }, { "step": 13, "inputTokenIDs": [ 4, 13, 4, 4, 5 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 0, 2, 0, 2, 0 ], "topCandidateTokenIDs": [ 4, 4, 13, 10, 10, 6, 4, 13, 6, 15 ], "topCandidateScores": [ -0.045690979808568954, -5.1910905838012695, -5.443279266357422, -5.965338706970215, -6.375974655151367, -6.755446434020996, -7.251867294311523, -8.66057300567627, -9.307238578796387, -10.167266845703125 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.3794717788696289 }, { "step": 14, "inputTokenIDs": [ 4, 4, 13, 10, 10 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 3, 3, 3, 4, 3 ], "topCandidateTokenIDs": [ 10, 10, 10, 7, 7, 18, 12, 5, 4, 9 ], "topCandidateScores": [ -0.045690979808568954, -5.191091060638428, -5.44327974319458, -5.965969562530518, -6.376102447509766, -14.036364555358887, -14.983872413635254, -15.336197853088379, -15.775224685668945, -16.094585418701172 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 7.660262107849121 }, { "step": 15, "inputTokenIDs": [ 10, 10, 10, 7, 7 ], "topCandidateParents": [ 0, 1, 2, 4, 3, 3, 3, 0, 3, 1 ], "topCandidateTokenIDs": [ 7, 7, 7, 4, 5, 11, 6, 18, 12, 18 ], "topCandidateScores": [ -0.04591649770736694, -5.1959381103515625, -5.443283557891846, -6.376204013824463, -6.7128071784973145, -6.867647647857666, -8.247518539428711, -8.679434776306152, -10.017292022705078, -10.679744720458984 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.15484046936035156 }, { "step": 16, "inputTokenIDs": [ 7, 7, 7, 4, 5 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 4, 0, 4, 2, 4 ], "topCandidateTokenIDs": [ 4, 4, 4, 4, 5, 11, 13, 12, 13, 6 ], "topCandidateScores": [ -0.04596012830734253, -5.19618558883667, -5.44518518447876, -6.376368999481201, -6.915571212768555, -8.524092674255371, -10.10172176361084, -11.014280319213867, -11.715117454528809, -11.990289688110352 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 1.6085214614868164 }, { "step": 17, "inputTokenIDs": [ 4, 4, 4, 4, 5 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 4, 0, 0, 4, 1 ], "topCandidateTokenIDs": [ 4, 4, 4, 8, 12, 11, 6, 13, 6, 6 ], "topCandidateScores": [ -0.04603153094649315, -5.196540355682373, -5.445662975311279, -6.376368999481201, -6.978163719177246, -9.844659805297852, -10.211792945861816, -10.380880355834961, -12.095719337463379, -13.440149307250977 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 2.8664960861206055 }, { "step": 18, "inputTokenIDs": [ 4, 4, 4, 8, 12 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 4, 4, 3, 3, 3 ], "topCandidateTokenIDs": [ 8, 8, 8, 3, 8, 11, 5, 18, 5, 9 ], "topCandidateScores": [ -0.04603153094649315, -5.196540355682373, -5.445662975311279, -6.376388072967529, -6.978397846221924, -15.422286987304688, -18.096302032470703, -18.096410751342773, -18.722698211669922, -19.42149543762207 ], "activeCandidateIndices": [ 0, 1, 2, 5, 4 ], "finished": [ { "tokenIDs": [ 4, 8, 4, 4, 4, 6, 5, 10, 5, 5, 12, 5, 5, 10, 7, 4, 4, 8 ], "score": -6.376388072967529, "finishedAt": 18, "endedWithEOS": true } ], "exactTiesInTopCandidates": 0, "beamCutoffGap": 8.443889617919922 }, { "step": 19, "inputTokenIDs": [ 8, 8, 8, 11, 8 ], "topCandidateParents": [ 0, 1, 2, 4, 4, 4, 0, 0, 4, 0 ], "topCandidateTokenIDs": [ 3, 3, 3, 3, 4, 5, 18, 5, 12, 9 ], "topCandidateScores": [ -0.04603665694594383, -5.196565628051758, -5.445723056793213, -6.986639976501465, -12.623437881469727, -12.659830093383789, -12.913908958435059, -13.819579124450684, -13.89773941040039, -14.964470863342285 ], "activeCandidateIndices": [ 5, 6, 7, 8, 4 ], "finished": [ { "tokenIDs": [ 4, 8, 4, 4, 4, 6, 18, 4, 10, 4, 4, 13, 4, 4, 10, 7, 4, 4, 8 ], "score": -0.04603665694594383, "finishedAt": 19, "endedWithEOS": true }, { "tokenIDs": [ 4, 8, 4, 4, 4, 6, 18, 4, 10, 4, 4, 4, 13, 4, 10, 7, 4, 4, 8 ], "score": -5.196565628051758, "finishedAt": 19, "endedWithEOS": true }, { "tokenIDs": [ 4, 8, 4, 4, 4, 6, 18, 4, 10, 4, 4, 4, 4, 13, 10, 7, 4, 4, 8 ], "score": -5.445723056793213, "finishedAt": 19, "endedWithEOS": true }, { "tokenIDs": [ 5, 8, 11, 5, 5, 6, 4, 10, 4, 4, 4, 4, 4, 10, 7, 5, 5, 12, 8 ], "score": -6.986639976501465, "finishedAt": 19, "endedWithEOS": true } ], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.0363922119140625 } ], "compute_seconds": 0.13769999998807908, "runtime_evidence": { "ortWasmLinearMemoryBytes": 290717696, "rdkitWasmLinearMemoryBytes": 16777216, "gpuProfileEvents": 0, "gpuKernelTypes": [], "gpuMemoryBytes": null, "gpuQueueSubmissions": 0, "gpuComputePipelines": 0, "gpuDeviceLost": null, "peakResidentBytes": null, "cpuSeconds": null, "physicalDevicePerformance": false }, "kind": "prediction", "method": "ASKCOS Augmented Transformer · Pistachio 23Q3", "source_url": "https://github.com/ASKCOS/augmented_transformer", "precision": "FP32", "execution_target": "browser", "scope": "Predicted candidates; reaction conditions and experimental yield are not modeled." } }, { "id": "chiral-acylation", "status": "passed", "networkBytes": 0, "receipt": { "identity": { "taskId": "candidate-prediction:2fc51f01-8835-4cc3-8b96-9077c8918cfd", "attemptId": "attempt:958d54a4-72d6-453e-ac3d-c68c89666db3", "generation": 1 }, "taskType": "reaction.product-prediction", "scientificProfileDigest": "72a1584ff8787ad3e0ed91021c054ef4b8869cdd79082c08f3f0561371240177", "implementationDigest": "9ba10bb450b9fc412dfc6acdcf2d8761fe6507645cc3265484b791dcde8622fa", "qualificationId": "prediction-fp32-q3-v2-product-v1", "normalizedInputHash": "c15dc009c96a47c64ffda361a8cb934671c51fe60c9fade2820e2050e4c1472e", "device": { "id": "candidate-prediction", "target": "browser", "class": "desktop", "connection": "online", "protocolVersion": 1, "implementationDigests": [ "9ba10bb450b9fc412dfc6acdcf2d8761fe6507645cc3265484b791dcde8622fa" ] }, "sourceReceipts": [ { "kind": "runtime", "build": "rolldown-1.0.3:sha256:db763a3d22d5a2b4c47dceca233f1d6bab58d76ab1e8a2302371f3c591cdf842", "concurrency": 1, "variant": "serial", "memoryBudgetBytes": 1610612736 } ], "parentResults": [], "startedAt": "2026-10-10T00:20:07.534Z", "endedAt": "2026-10-10T00:20:07.667Z", "wallSeconds": 0.133, "cpuSeconds": null, "peakResidentBytes": null, "quality": "complete", "warnings": [] }, "payload": { "reactants": "CC(=O)Cl.COC(=O)[C@H](C)N", "candidates": [ { "smiles": "COC(=O)[C@H](C)NC(C)=O", "formula": "C6H11NO3", "model_score": -0.21808506548404694, "rank": 1 }, { "smiles": "COC(=O)C(C)NC(C)=O", "formula": "C6H11NO3", "model_score": -1.9402873516082764, "rank": 2 }, { "smiles": "CC(=O)N[C@@H](C)C(=O)O", "formula": "C5H9NO3", "model_score": -4.3448615074157715, "rank": 3 }, { "smiles": "COC(=O)[C@@H](C)NC(C)=O", "formula": "C6H11NO3", "model_score": -4.355153560638428, "rank": 4 }, { "smiles": "CC(=O)NC(C)C(=O)O", "formula": "C5H9NO3", "model_score": -5.383396148681641, "rank": 5 } ], "rejected_candidates": 0, "unknown_tokens": [], "conditions_modeled": false, "unspecified_stereo_candidates": [ 2, 5 ], "decoder_steps": 19, "hypotheses": [ { "tokenIDs": [ 5, 9, 5, 6, 11, 9, 7, 19, 6, 5, 7, 12, 5, 6, 5, 7, 11, 9 ], "score": -0.21808506548404694, "finishedAt": 18, "endedWithEOS": true }, { "tokenIDs": [ 5, 9, 5, 6, 11, 9, 7, 5, 6, 5, 7, 12, 5, 6, 5, 7, 11, 9 ], "score": -1.9402873516082764, "finishedAt": 18, "endedWithEOS": true }, { "tokenIDs": [ 5, 5, 6, 11, 9, 7, 12, 20, 6, 5, 7, 5, 6, 11, 9, 7, 9 ], "score": -4.3448615074157715, "finishedAt": 17, "endedWithEOS": true }, { "tokenIDs": [ 5, 9, 5, 6, 11, 9, 7, 20, 6, 5, 7, 12, 5, 6, 5, 7, 11, 9 ], "score": -4.355153560638428, "finishedAt": 18, "endedWithEOS": true }, { "tokenIDs": [ 5, 5, 6, 11, 9, 7, 12, 5, 6, 5, 7, 5, 6, 11, 9, 7, 9 ], "score": -5.383396148681641, "finishedAt": 17, "endedWithEOS": true } ], "trace": [ { "step": 0, "inputTokenIDs": [ 2 ], "topCandidateParents": [ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ], "topCandidateTokenIDs": [ 5, 9, 12, 4, 17, 19, 20, 39, 45, 13 ], "topCandidateScores": [ -0.002977345371618867, -6.711277008056641, -6.785185813903809, -8.749672889709473, -9.160310745239258, -9.302785873413086, -9.426324844360352, -9.707621574401855, -9.906000137329102, -11.51399040222168 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.14247512817382812 }, { "step": 1, "inputTokenIDs": [ 5, 9, 12, 4, 17 ], "topCandidateParents": [ 0, 0, 0, 1, 0, 2, 0, 2, 0, 0 ], "topCandidateTokenIDs": [ 9, 5, 6, 11, 12, 5, 19, 6, 11, 20 ], "topCandidateScores": [ -0.029188843443989754, -3.795246124267578, -6.6935272216796875, -6.91583776473999, -6.940854072570801, -7.486302852630615, -7.763842582702637, -7.861164569854736, -8.290802955627441, -8.451936721801758 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.5454487800598145 }, { "step": 2, "inputTokenIDs": [ 9, 5, 6, 11, 12 ], "topCandidateParents": [ 0, 1, 3, 1, 4, 1, 2, 1, 2, 2 ], "topCandidateTokenIDs": [ 5, 6, 5, 12, 5, 9, 11, 5, 5, 12 ], "topCandidateScores": [ -0.02930375374853611, -3.874342441558838, -6.9304351806640625, -7.274049758911133, -7.304928302764893, -7.437256813049316, -7.862715721130371, -7.9941277503967285, -8.192048072814941, -8.290908813476562 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.13232851028442383 }, { "step": 3, "inputTokenIDs": [ 5, 6, 5, 12, 5 ], "topCandidateParents": [ 0, 1, 2, 4, 3, 1, 1, 0, 2, 0 ], "topCandidateTokenIDs": [ 6, 11, 6, 6, 6, 5, 12, 5, 8, 19 ], "topCandidateScores": [ -0.02957777865231037, -3.904578685760498, -7.073570251464844, -7.383853435516357, -7.497483730316162, -8.014257431030273, -8.223215103149414, -9.055543899536133, -9.240827560424805, -9.263469696044922 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.5167737007141113 }, { "step": 4, "inputTokenIDs": [ 6, 11, 6, 6, 6 ], "topCandidateParents": [ 0, 1, 3, 4, 2, 2, 2, 3, 0, 2 ], "topCandidateTokenIDs": [ 11, 9, 11, 5, 9, 12, 5, 5, 5, 17 ], "topCandidateScores": [ -0.029655618593096733, -3.904714822769165, -7.484605312347412, -7.552600383758545, -8.151769638061523, -8.275306701660156, -8.327836990356445, -9.763494491577148, -9.851593971252441, -10.915740966796875 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.12353706359863281 }, { "step": 5, "inputTokenIDs": [ 11, 9, 11, 5, 9 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 4, 3, 0, 0, 3 ], "topCandidateTokenIDs": [ 9, 7, 9, 6, 5, 7, 5, 21, 12, 7 ], "topCandidateScores": [ -0.029701154679059982, -3.904714822769165, -7.485257148742676, -7.715719223022461, -8.455719947814941, -9.515774726867676, -9.592985153198242, -10.40040111541748, -11.424263954162598, -11.641234397888184 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 1.0600547790527344 }, { "step": 6, "inputTokenIDs": [ 9, 7, 9, 6, 5 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 1, 1, 1, 3, 1 ], "topCandidateTokenIDs": [ 7, 12, 7, 5, 7, 5, 9, 4, 11, 19 ], "topCandidateScores": [ -0.029701154679059982, -3.918747663497925, -7.485257148742676, -7.735801696777344, -8.523397445678711, -8.762365341186523, -9.303905487060547, -11.533907890319824, -11.658872604370117, -11.997807502746582 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.2389678955078125 }, { "step": 7, "inputTokenIDs": [ 7, 12, 7, 5, 7 ], "topCandidateParents": [ 0, 0, 1, 0, 1, 1, 0, 3, 2, 0 ], "topCandidateTokenIDs": [ 19, 5, 20, 20, 5, 19, 12, 7, 5, 35 ], "topCandidateScores": [ -0.21426841616630554, -1.9006978273391724, -4.310823440551758, -4.345911502838135, -5.256423473358154, -6.887186050415039, -7.300346374511719, -7.736484527587891, -8.081028938293457, -8.342544555664062 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 1.6307625770568848 }, { "step": 8, "inputTokenIDs": [ 19, 5, 20, 20, 5 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 1, 1, 1, 4, 1 ], "topCandidateTokenIDs": [ 6, 6, 6, 6, 6, 5, 12, 19, 5, 20 ], "topCandidateScores": [ -0.21428796648979187, -1.9307142496109009, -4.311344146728516, -4.346071720123291, -5.306532859802246, -5.822364330291748, -6.888191223144531, -8.336962699890137, -8.354879379272461, -8.972282409667969 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.515831470489502 }, { "step": 9, "inputTokenIDs": [ 6, 6, 6, 6, 6 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 0, 1, 1, 3, 4 ], "topCandidateTokenIDs": [ 5, 5, 5, 5, 5, 12, 12, 11, 12, 11 ], "topCandidateScores": [ -0.2144528180360794, -1.9317352771759033, -4.311468601226807, -4.350294589996338, -5.310425758361816, -9.22854232788086, -9.540380477905273, -9.657879829406738, -9.829536437988281, -10.972410202026367 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 3.918116569519043 }, { "step": 10, "inputTokenIDs": [ 5, 5, 5, 5, 5 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 0, 4, 0, 1, 4 ], "topCandidateTokenIDs": [ 7, 7, 7, 7, 7, 5, 6, 4, 5, 5 ], "topCandidateScores": [ -0.21484196186065674, -1.9323413372039795, -4.313828468322754, -4.350774765014648, -5.338938236236572, -8.537479400634766, -9.127545356750488, -9.630776405334473, -9.68397331237793, -10.655356407165527 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 3.1985411643981934 }, { "step": 11, "inputTokenIDs": [ 7, 7, 7, 7, 7 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 0, 1, 1, 1, 0 ], "topCandidateTokenIDs": [ 12, 12, 5, 12, 5, 5, 5, 6, 11, 9 ], "topCandidateScores": [ -0.21560543775558472, -1.9369183778762817, -4.313883304595947, -4.352342128753662, -5.343329429626465, -7.608434200286865, -8.269943237304688, -8.486258506774902, -8.787090301513672, -9.555691719055176 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 2.2651047706604004 }, { "step": 12, "inputTokenIDs": [ 12, 12, 5, 12, 5 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 0, 0, 0, 1, 1 ], "topCandidateTokenIDs": [ 5, 5, 6, 5, 6, 6, 11, 9, 6, 11 ], "topCandidateScores": [ -0.2165064960718155, -1.9387125968933105, -4.3150482177734375, -4.353433132171631, -5.346981525421143, -7.890894412994385, -8.679862976074219, -8.994867324829102, -9.139042854309082, -9.178132057189941 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 2.543912887573242 }, { "step": 13, "inputTokenIDs": [ 5, 5, 6, 5, 6 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 2, 0, 1, 0, 4 ], "topCandidateTokenIDs": [ 6, 6, 11, 6, 11, 12, 11, 11, 5, 12 ], "topCandidateScores": [ -0.21668779850006104, -1.939199447631836, -4.323285102844238, -4.353921413421631, -5.359565258026123, -9.274250030517578, -9.349300384521484, -9.961669921875, -10.091134071350098, -10.24367904663086 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 3.914684772491455 }, { "step": 14, "inputTokenIDs": [ 6, 6, 11, 6, 11 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 0, 1, 3, 0, 1 ], "topCandidateTokenIDs": [ 5, 5, 9, 5, 9, 11, 11, 11, 12, 12 ], "topCandidateScores": [ -0.2179720550775528, -1.9401276111602783, -4.323296546936035, -4.355041980743408, -5.3595805168151855, -6.891841411590576, -8.950550079345703, -11.176637649536133, -11.20046329498291, -12.644242286682129 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 1.5322608947753906 }, { "step": 15, "inputTokenIDs": [ 5, 5, 9, 5, 9 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 0, 0, 0, 1, 0 ], "topCandidateTokenIDs": [ 7, 7, 7, 7, 7, 23, 5, 17, 5, 6 ], "topCandidateScores": [ -0.21798564493656158, -1.940150260925293, -4.323296546936035, -4.35506010055542, -5.3595805168151855, -12.601913452148438, -12.645771026611328, -13.522100448608398, -13.630465507507324, -14.101533889770508 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 7.242332935333252 }, { "step": 16, "inputTokenIDs": [ 7, 7, 7, 7, 7 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 2, 2, 0, 4, 2 ], "topCandidateTokenIDs": [ 11, 11, 9, 11, 9, 12, 17, 5, 12, 5 ], "topCandidateScores": [ -0.2180251032114029, -1.9402374029159546, -4.330799102783203, -4.3551106452941895, -5.366649150848389, -9.900688171386719, -10.337206840515137, -10.752748489379883, -11.154130935668945, -11.17082691192627 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 4.53403902053833 }, { "step": 17, "inputTokenIDs": [ 11, 11, 9, 11, 9 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 2, 4, 0, 1, 2 ], "topCandidateTokenIDs": [ 9, 9, 3, 9, 3, 5, 5, 21, 21, 43 ], "topCandidateScores": [ -0.21808506548404694, -1.9402873516082764, -4.3448615074157715, -4.355153560638428, -5.383396148681641, -8.72775650024414, -9.582464218139648, -9.989642143249512, -11.91128158569336, -12.5326509475708 ], "activeCandidateIndices": [ 0, 1, 5, 3, 6 ], "finished": [ { "tokenIDs": [ 5, 5, 6, 11, 9, 7, 12, 20, 6, 5, 7, 5, 6, 11, 9, 7, 9 ], "score": -4.3448615074157715, "finishedAt": 17, "endedWithEOS": true }, { "tokenIDs": [ 5, 5, 6, 11, 9, 7, 12, 5, 6, 5, 7, 5, 6, 11, 9, 7, 9 ], "score": -5.383396148681641, "finishedAt": 17, "endedWithEOS": true } ], "exactTiesInTopCandidates": 0, "beamCutoffGap": 3.3443603515625 }, { "step": 18, "inputTokenIDs": [ 9, 9, 5, 9, 5 ], "topCandidateParents": [ 0, 1, 3, 2, 2, 4, 2, 2, 2, 4 ], "topCandidateTokenIDs": [ 3, 3, 3, 3, 4, 3, 6, 5, 17, 5 ], "topCandidateScores": [ -0.21808506548404694, -1.9402873516082764, -4.355153560638428, -9.957013130187988, -10.015501022338867, -10.120487213134766, -10.355461120605469, -11.004220962524414, -11.089729309082031, -11.703943252563477 ], "activeCandidateIndices": [ 6, 7, 8, 9, 4 ], "finished": [ { "tokenIDs": [ 5, 9, 5, 6, 11, 9, 7, 19, 6, 5, 7, 12, 5, 6, 5, 7, 11, 9 ], "score": -0.21808506548404694, "finishedAt": 18, "endedWithEOS": true }, { "tokenIDs": [ 5, 9, 5, 6, 11, 9, 7, 5, 6, 5, 7, 12, 5, 6, 5, 7, 11, 9 ], "score": -1.9402873516082764, "finishedAt": 18, "endedWithEOS": true }, { "tokenIDs": [ 5, 9, 5, 6, 11, 9, 7, 20, 6, 5, 7, 12, 5, 6, 5, 7, 11, 9 ], "score": -4.355153560638428, "finishedAt": 18, "endedWithEOS": true }, { "tokenIDs": [ 5, 5, 6, 11, 9, 7, 12, 20, 6, 5, 7, 5, 6, 11, 9, 7, 9, 5 ], "score": -9.957013130187988, "finishedAt": 18, "endedWithEOS": true } ], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.10498619079589844 } ], "compute_seconds": 0.128, "runtime_evidence": { "ortWasmLinearMemoryBytes": 290717696, "rdkitWasmLinearMemoryBytes": 16777216, "gpuProfileEvents": 0, "gpuKernelTypes": [], "gpuMemoryBytes": null, "gpuQueueSubmissions": 0, "gpuComputePipelines": 0, "gpuDeviceLost": null, "peakResidentBytes": null, "cpuSeconds": null, "physicalDevicePerformance": false }, "kind": "prediction", "method": "ASKCOS Augmented Transformer · Pistachio 23Q3", "source_url": "https://github.com/ASKCOS/augmented_transformer", "precision": "FP32", "execution_target": "browser", "scope": "Predicted candidates; reaction conditions and experimental yield are not modeled." } }, { "id": "ez-trans", "status": "passed", "networkBytes": 0, "receipt": { "identity": { "taskId": "candidate-prediction:6025a219-939a-452d-a4ab-4614f0ae1f0a", "attemptId": "attempt:1d52e44f-e990-480d-a334-25dc5a5b006f", "generation": 1 }, "taskType": "reaction.product-prediction", "scientificProfileDigest": "72a1584ff8787ad3e0ed91021c054ef4b8869cdd79082c08f3f0561371240177", "implementationDigest": "9ba10bb450b9fc412dfc6acdcf2d8761fe6507645cc3265484b791dcde8622fa", "qualificationId": "prediction-fp32-q3-v2-product-v1", "normalizedInputHash": "2e16f76d537d5165509b628fcf8d53109c4e0b628a588742e212699063cd25d6", "device": { "id": "candidate-prediction", "target": "browser", "class": "desktop", "connection": "online", "protocolVersion": 1, "implementationDigests": [ "9ba10bb450b9fc412dfc6acdcf2d8761fe6507645cc3265484b791dcde8622fa" ] }, "sourceReceipts": [ { "kind": "runtime", "build": "rolldown-1.0.3:sha256:db763a3d22d5a2b4c47dceca233f1d6bab58d76ab1e8a2302371f3c591cdf842", "concurrency": 1, "variant": "serial", "memoryBudgetBytes": 1610612736 } ], "parentResults": [], "startedAt": "2026-10-10T00:20:07.724Z", "endedAt": "2026-10-10T00:20:07.787Z", "wallSeconds": 0.063, "cpuSeconds": null, "peakResidentBytes": null, "quality": "complete", "warnings": [] }, "payload": { "reactants": "C/C=C/C.OO", "candidates": [ { "smiles": "CC1OC1C", "formula": "C4H8O", "model_score": -0.4771520793437958, "rank": 1 }, { "smiles": "C[C@@H]1O[C@H]1C", "formula": "C4H8O", "model_score": -2.8724677562713623, "rank": 2 }, { "smiles": "C[C@@H]1O[C@@H]1C", "formula": "C4H8O", "model_score": -3.3815674781799316, "rank": 3 }, { "smiles": "C/C=C/C", "formula": "C4H8", "model_score": -3.4124631881713867, "rank": 4 }, { "smiles": "C/C=C/CO", "formula": "C4H8O", "model_score": -4.3242926597595215, "rank": 5 } ], "rejected_candidates": 0, "unknown_tokens": [], "conditions_modeled": false, "unspecified_stereo_candidates": [ 1 ], "decoder_steps": 9, "hypotheses": [ { "tokenIDs": [ 5, 5, 8, 9, 5, 8, 5 ], "score": -0.4771520793437958, "finishedAt": 7, "endedWithEOS": true }, { "tokenIDs": [ 5, 20, 8, 9, 19, 8, 5 ], "score": -2.8724677562713623, "finishedAt": 7, "endedWithEOS": true }, { "tokenIDs": [ 5, 19, 8, 9, 19, 8, 5 ], "score": -3.3815674781799316, "finishedAt": 7, "endedWithEOS": true }, { "tokenIDs": [ 5, 27, 5, 11, 5, 27, 5 ], "score": -3.4124631881713867, "finishedAt": 7, "endedWithEOS": true }, { "tokenIDs": [ 5, 27, 5, 11, 5, 27, 5, 9 ], "score": -4.3242926597595215, "finishedAt": 8, "endedWithEOS": true } ], "trace": [ { "step": 0, "inputTokenIDs": [ 2 ], "topCandidateParents": [ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ], "topCandidateTokenIDs": [ 5, 9, 20, 19, 99, 4, 39, 30, 89, 94 ], "topCandidateScores": [ -0.011021922342479229, -4.965799808502197, -6.350081920623779, -6.378841876983643, -9.184464454650879, -9.536847114562988, -10.052536964416504, -10.334227561950684, -10.342642784118652, -10.345659255981445 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.3523826599121094 }, { "step": 1, "inputTokenIDs": [ 5, 9, 20, 19, 99 ], "topCandidateParents": [ 0, 0, 0, 0, 0, 0, 1, 1, 2, 3 ], "topCandidateTokenIDs": [ 5, 19, 20, 27, 8, 6, 5, 8, 8, 8 ], "topCandidateScores": [ -0.291762113571167, -2.735051155090332, -2.7841005325317383, -2.894178867340088, -3.475276470184326, -3.636446714401245, -5.911709785461426, -5.914188861846924, -6.469922065734863, -6.650637626647949 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.16117024421691895 }, { "step": 2, "inputTokenIDs": [ 5, 19, 20, 27, 8 ], "topCandidateParents": [ 0, 0, 1, 2, 3, 0, 4, 1, 0, 2 ], "topCandidateTokenIDs": [ 8, 6, 8, 8, 5, 5, 6, 6, 19, 6 ], "topCandidateScores": [ -0.4646473228931427, -2.5990138053894043, -2.7630913257598877, -2.798722743988037, -2.8941962718963623, -3.1764163970947266, -3.4955801963806152, -6.32338809967041, -6.991950988769531, -7.016947269439697 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.28222012519836426 }, { "step": 3, "inputTokenIDs": [ 8, 6, 8, 8, 5 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 0, 1, 4, 2, 2 ], "topCandidateTokenIDs": [ 9, 9, 9, 9, 11, 5, 5, 6, 20, 19 ], "topCandidateScores": [ -0.4750363826751709, -2.65556263923645, -2.7708871364593506, -2.8043785095214844, -2.9037935733795166, -5.0529704093933105, -5.532255172729492, -7.557767868041992, -8.635421752929688, -8.676826477050781 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 2.149176836013794 }, { "step": 4, "inputTokenIDs": [ 9, 9, 9, 9, 11 ], "topCandidateParents": [ 0, 1, 3, 4, 2, 2, 3, 0, 0, 2 ], "topCandidateTokenIDs": [ 5, 7, 19, 5, 19, 20, 20, 19, 20, 5 ], "topCandidateScores": [ -0.4754519760608673, -2.656714916229248, -2.8716423511505127, -2.903797149658203, -3.380707025527954, -3.557464838027954, -5.548069953918457, -8.804023742675781, -9.58542251586914, -9.853368759155273 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.1767578125 }, { "step": 5, "inputTokenIDs": [ 5, 7, 19, 5, 19 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 3, 3, 1, 1, 0 ], "topCandidateTokenIDs": [ 8, 5, 8, 27, 8, 38, 6, 19, 20, 6 ], "topCandidateScores": [ -0.47549548745155334, -2.6590089797973633, -2.87166166305542, -3.0362789630889893, -3.3807125091552734, -5.6700639724731445, -5.699435234069824, -9.309453964233398, -9.650466918945312, -10.644403457641602 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 2.289351463317871 }, { "step": 6, "inputTokenIDs": [ 8, 5, 8, 27, 8 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 0, 1, 3, 1, 1 ], "topCandidateTokenIDs": [ 5, 6, 5, 5, 5, 6, 8, 9, 5, 11 ], "topCandidateScores": [ -0.4767782986164093, -2.6623165607452393, -2.871685743331909, -3.03922438621521, -3.3807313442230225, -7.14118766784668, -8.76173210144043, -8.94520378112793, -9.754562377929688, -11.439372062683105 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 3.7604563236236572 }, { "step": 7, "inputTokenIDs": [ 5, 6, 5, 5, 5 ], "topCandidateParents": [ 0, 1, 2, 4, 3, 3, 3, 3, 0, 3 ], "topCandidateTokenIDs": [ 3, 5, 3, 3, 3, 9, 6, 5, 5, 11 ], "topCandidateScores": [ -0.4771520793437958, -2.662987470626831, -2.8724677562713623, -3.3815674781799316, -3.4124631881713867, -4.32077169418335, -7.240205764770508, -7.401206970214844, -8.840381622314453, -9.188681602478027 ], "activeCandidateIndices": [ 5, 1, 6, 7, 8 ], "finished": [ { "tokenIDs": [ 5, 5, 8, 9, 5, 8, 5 ], "score": -0.4771520793437958, "finishedAt": 7, "endedWithEOS": true }, { "tokenIDs": [ 5, 20, 8, 9, 19, 8, 5 ], "score": -2.8724677562713623, "finishedAt": 7, "endedWithEOS": true }, { "tokenIDs": [ 5, 19, 8, 9, 19, 8, 5 ], "score": -3.3815674781799316, "finishedAt": 7, "endedWithEOS": true }, { "tokenIDs": [ 5, 27, 5, 11, 5, 27, 5 ], "score": -3.4124631881713867, "finishedAt": 7, "endedWithEOS": true } ], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.9083085060119629 }, { "step": 8, "inputTokenIDs": [ 9, 5, 6, 5, 5 ], "topCandidateParents": [ 1, 0, 2, 3, 2, 3, 4, 3, 2, 3 ], "topCandidateTokenIDs": [ 7, 3, 11, 3, 5, 9, 3, 11, 9, 6 ], "topCandidateScores": [ -2.6630167961120605, -4.3242926597595215, -7.660656452178955, -8.324188232421875, -8.651915550231934, -8.780599594116211, -8.88615894317627, -9.553770065307617, -9.612655639648438, -9.877127647399902 ], "activeCandidateIndices": [ 0, 5, 2, 7, 4 ], "finished": [ { "tokenIDs": [ 5, 27, 5, 11, 5, 27, 5, 9 ], "score": -4.3242926597595215, "finishedAt": 8, "endedWithEOS": true }, { "tokenIDs": [ 5, 27, 5, 11, 5, 27, 5, 5 ], "score": -8.324188232421875, "finishedAt": 8, "endedWithEOS": true } ], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.12868404388427734 } ], "compute_seconds": 0.05919999998807907, "runtime_evidence": { "ortWasmLinearMemoryBytes": 290717696, "rdkitWasmLinearMemoryBytes": 16777216, "gpuProfileEvents": 0, "gpuKernelTypes": [], "gpuMemoryBytes": null, "gpuQueueSubmissions": 0, "gpuComputePipelines": 0, "gpuDeviceLost": null, "peakResidentBytes": null, "cpuSeconds": null, "physicalDevicePerformance": false }, "kind": "prediction", "method": "ASKCOS Augmented Transformer · Pistachio 23Q3", "source_url": "https://github.com/ASKCOS/augmented_transformer", "precision": "FP32", "execution_target": "browser", "scope": "Predicted candidates; reaction conditions and experimental yield are not modeled." } }, { "id": "ez-cis", "status": "passed", "networkBytes": 0, "receipt": { "identity": { "taskId": "candidate-prediction:a45c35bc-48ad-4e91-ab00-ecdb674d7670", "attemptId": "attempt:5e9204af-bafe-454d-8ded-95bf64320c08", "generation": 1 }, "taskType": "reaction.product-prediction", "scientificProfileDigest": "72a1584ff8787ad3e0ed91021c054ef4b8869cdd79082c08f3f0561371240177", "implementationDigest": "9ba10bb450b9fc412dfc6acdcf2d8761fe6507645cc3265484b791dcde8622fa", "qualificationId": "prediction-fp32-q3-v2-product-v1", "normalizedInputHash": "902b4d299f91f77760d4360847e38d215f9918506d140dbbb0234c965464d36b", "device": { "id": "candidate-prediction", "target": "browser", "class": "desktop", "connection": "online", "protocolVersion": 1, "implementationDigests": [ "9ba10bb450b9fc412dfc6acdcf2d8761fe6507645cc3265484b791dcde8622fa" ] }, "sourceReceipts": [ { "kind": "runtime", "build": "rolldown-1.0.3:sha256:db763a3d22d5a2b4c47dceca233f1d6bab58d76ab1e8a2302371f3c591cdf842", "concurrency": 1, "variant": "serial", "memoryBudgetBytes": 1610612736 } ], "parentResults": [], "startedAt": "2026-10-10T00:20:07.855Z", "endedAt": "2026-10-10T00:20:07.919Z", "wallSeconds": 0.064, "cpuSeconds": null, "peakResidentBytes": null, "quality": "complete", "warnings": [] }, "payload": { "reactants": "C/C=C\\C.OO", "candidates": [ { "smiles": "CC1OC1C", "formula": "C4H8O", "model_score": -0.35985568165779114, "rank": 1 }, { "smiles": "C[C@@H]1O[C@H]1C", "formula": "C4H8O", "model_score": -3.2618894577026367, "rank": 2 }, { "smiles": "C[C@@H]1O[C@@H]1C", "formula": "C4H8O", "model_score": -3.780691385269165, "rank": 3 }, { "smiles": "C/C=C\\C", "formula": "C4H8", "model_score": -3.874783515930176, "rank": 4 }, { "smiles": "C/C=C\\CO", "formula": "C4H8O", "model_score": -4.086797714233398, "rank": 5 } ], "rejected_candidates": 0, "unknown_tokens": [], "conditions_modeled": false, "unspecified_stereo_candidates": [ 1 ], "decoder_steps": 9, "hypotheses": [ { "tokenIDs": [ 5, 5, 8, 9, 5, 8, 5 ], "score": -0.35985568165779114, "finishedAt": 7, "endedWithEOS": true }, { "tokenIDs": [ 5, 20, 8, 9, 19, 8, 5 ], "score": -3.2618894577026367, "finishedAt": 7, "endedWithEOS": true }, { "tokenIDs": [ 5, 19, 8, 9, 19, 8, 5 ], "score": -3.780691385269165, "finishedAt": 7, "endedWithEOS": true }, { "tokenIDs": [ 5, 27, 5, 11, 5, 38, 5 ], "score": -3.874783515930176, "finishedAt": 7, "endedWithEOS": true }, { "tokenIDs": [ 5, 27, 5, 11, 5, 38, 5, 9 ], "score": -4.086797714233398, "finishedAt": 8, "endedWithEOS": true } ], "trace": [ { "step": 0, "inputTokenIDs": [ 2 ], "topCandidateParents": [ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ], "topCandidateTokenIDs": [ 5, 9, 19, 20, 99, 4, 30, 6, 21, 17 ], "topCandidateScores": [ -0.014110793359577656, -4.567256450653076, -6.426223278045654, -6.444135665893555, -9.30447769165039, -10.016205787658691, -10.476475715637207, -10.6841459274292, -10.699138641357422, -10.725959777832031 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.7117280960083008 }, { "step": 1, "inputTokenIDs": [ 5, 9, 19, 20, 99 ], "topCandidateParents": [ 0, 0, 0, 0, 0, 0, 1, 1, 3, 2 ], "topCandidateTokenIDs": [ 5, 27, 20, 19, 8, 6, 8, 5, 8, 8 ], "topCandidateScores": [ -0.24594543874263763, -2.893911361694336, -3.164410352706909, -3.1701276302337646, -3.366872787475586, -3.6026864051818848, -5.249849319458008, -5.78169059753418, -6.524770259857178, -6.590531349182129 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.23581361770629883 }, { "step": 2, "inputTokenIDs": [ 5, 27, 20, 19, 8 ], "topCandidateParents": [ 0, 1, 0, 2, 3, 4, 0, 3, 0, 2 ], "topCandidateTokenIDs": [ 8, 5, 6, 8, 8, 6, 5, 6, 11, 6 ], "topCandidateScores": [ -0.34982916712760925, -2.8939192295074463, -2.944125175476074, -3.172332763671875, -3.187847375869751, -3.3806300163269043, -3.7661166191101074, -7.212333679199219, -7.237873077392578, -8.006987571716309 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.19278264045715332 }, { "step": 3, "inputTokenIDs": [ 8, 5, 6, 8, 8 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 0, 2, 1, 4, 4 ], "topCandidateTokenIDs": [ 9, 11, 9, 9, 9, 5, 5, 6, 20, 19 ], "topCandidateScores": [ -0.35686179995536804, -2.9028501510620117, -2.9994513988494873, -3.177475690841675, -3.193988084793091, -5.333996772766113, -5.904970169067383, -7.625057220458984, -9.180001258850098, -9.265861511230469 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 2.1400086879730225 }, { "step": 4, "inputTokenIDs": [ 9, 11, 9, 9, 9 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 4, 3, 0, 2, 0 ], "topCandidateTokenIDs": [ 5, 5, 7, 19, 19, 20, 20, 19, 5, 20 ], "topCandidateScores": [ -0.357144296169281, -2.9028522968292236, -3.0018575191497803, -3.2610433101654053, -3.7798166275024414, -4.010561943054199, -5.711458206176758, -9.118246078491211, -9.216935157775879, -9.857720375061035 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.2307453155517578 }, { "step": 5, "inputTokenIDs": [ 5, 5, 7, 19, 19 ], "topCandidateParents": [ 0, 2, 1, 3, 4, 1, 1, 0, 2, 2 ], "topCandidateTokenIDs": [ 8, 5, 38, 8, 8, 27, 6, 6, 19, 20 ], "topCandidateScores": [ -0.35723167657852173, -3.0028488636016846, -3.254149913787842, -3.261061668395996, -3.7798216342926025, -4.462436199188232, -5.35852575302124, -9.80077075958252, -10.516427993774414, -10.892556190490723 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.6826145648956299 }, { "step": 6, "inputTokenIDs": [ 8, 5, 38, 8, 8 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 0, 2, 1, 1, 1 ], "topCandidateTokenIDs": [ 5, 6, 5, 5, 5, 6, 9, 8, 5, 11 ], "topCandidateScores": [ -0.3593687117099762, -3.005753517150879, -3.2566845417022705, -3.2610819339752197, -3.7798399925231934, -6.512508869171143, -9.29104995727539, -9.51193618774414, -10.157833099365234, -10.710474967956543 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 2.732668876647949 }, { "step": 7, "inputTokenIDs": [ 5, 6, 5, 5, 5 ], "topCandidateParents": [ 0, 1, 3, 4, 2, 2, 2, 2, 0, 0 ], "topCandidateTokenIDs": [ 3, 5, 3, 3, 3, 9, 5, 6, 5, 9 ], "topCandidateScores": [ -0.35985568165779114, -3.006608009338379, -3.2618894577026367, -3.780691385269165, -3.874783515930176, -4.07843017578125, -7.980703353881836, -8.08139419555664, -8.607841491699219, -9.441753387451172 ], "activeCandidateIndices": [ 5, 1, 6, 7, 8 ], "finished": [ { "tokenIDs": [ 5, 5, 8, 9, 5, 8, 5 ], "score": -0.35985568165779114, "finishedAt": 7, "endedWithEOS": true }, { "tokenIDs": [ 5, 20, 8, 9, 19, 8, 5 ], "score": -3.2618894577026367, "finishedAt": 7, "endedWithEOS": true }, { "tokenIDs": [ 5, 19, 8, 9, 19, 8, 5 ], "score": -3.780691385269165, "finishedAt": 7, "endedWithEOS": true }, { "tokenIDs": [ 5, 27, 5, 11, 5, 38, 5 ], "score": -3.874783515930176, "finishedAt": 7, "endedWithEOS": true } ], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.20364665985107422 }, { "step": 8, "inputTokenIDs": [ 9, 5, 5, 6, 5 ], "topCandidateParents": [ 1, 0, 3, 4, 2, 3, 2, 0, 0, 2 ], "topCandidateTokenIDs": [ 7, 3, 11, 3, 3, 5, 9, 5, 9, 5 ], "topCandidateScores": [ -3.0066449642181396, -4.086797714233398, -8.547270774841309, -8.697649955749512, -8.829604148864746, -9.375537872314453, -9.42243480682373, -9.543619155883789, -9.739808082580566, -10.255044937133789 ], "activeCandidateIndices": [ 0, 5, 2, 6, 7 ], "finished": [ { "tokenIDs": [ 5, 27, 5, 11, 5, 38, 5, 9 ], "score": -4.086797714233398, "finishedAt": 8, "endedWithEOS": true }, { "tokenIDs": [ 5, 5, 8, 9, 5, 8, 5, 5 ], "score": -8.697649955749512, "finishedAt": 8, "endedWithEOS": true }, { "tokenIDs": [ 5, 27, 5, 11, 5, 38, 5, 5 ], "score": -8.829604148864746, "finishedAt": 8, "endedWithEOS": true } ], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.545933723449707 } ], "compute_seconds": 0.05870000004768371, "runtime_evidence": { "ortWasmLinearMemoryBytes": 290717696, "rdkitWasmLinearMemoryBytes": 16777216, "gpuProfileEvents": 0, "gpuKernelTypes": [], "gpuMemoryBytes": null, "gpuQueueSubmissions": 0, "gpuComputePipelines": 0, "gpuDeviceLost": null, "peakResidentBytes": null, "cpuSeconds": null, "physicalDevicePerformance": false }, "kind": "prediction", "method": "ASKCOS Augmented Transformer · Pistachio 23Q3", "source_url": "https://github.com/ASKCOS/augmented_transformer", "precision": "FP32", "execution_target": "browser", "scope": "Predicted candidates; reaction conditions and experimental yield are not modeled." } }, { "id": "isotope-acylation", "status": "passed", "networkBytes": 0, "receipt": { "identity": { "taskId": "candidate-prediction:c8247dd5-cb51-47b6-9aee-ebace43d015b", "attemptId": "attempt:d17b84f8-7671-4c15-8184-664bf63ac4e9", "generation": 1 }, "taskType": "reaction.product-prediction", "scientificProfileDigest": "72a1584ff8787ad3e0ed91021c054ef4b8869cdd79082c08f3f0561371240177", "implementationDigest": "9ba10bb450b9fc412dfc6acdcf2d8761fe6507645cc3265484b791dcde8622fa", "qualificationId": "prediction-fp32-q3-v2-product-v1", "normalizedInputHash": "73d5fbba6c6e5f824f20e76f8d27789c2f3097260aff13824b998df3defa6372", "device": { "id": "candidate-prediction", "target": "browser", "class": "desktop", "connection": "online", "protocolVersion": 1, "implementationDigests": [ "9ba10bb450b9fc412dfc6acdcf2d8761fe6507645cc3265484b791dcde8622fa" ] }, "sourceReceipts": [ { "kind": "runtime", "build": "rolldown-1.0.3:sha256:db763a3d22d5a2b4c47dceca233f1d6bab58d76ab1e8a2302371f3c591cdf842", "concurrency": 1, "variant": "serial", "memoryBudgetBytes": 1610612736 } ], "parentResults": [], "startedAt": "2026-10-10T00:20:07.974Z", "endedAt": "2026-10-10T00:20:08.044Z", "wallSeconds": 0.07, "cpuSeconds": null, "peakResidentBytes": null, "quality": "complete", "warnings": [] }, "payload": { "reactants": "CN.[13CH3]C(=O)Cl", "candidates": [ { "smiles": "CNC([13CH3])=O", "formula": "C3H7NO", "model_score": -0.616362452507019, "rank": 1 } ], "rejected_candidates": 1, "unknown_tokens": [], "conditions_modeled": false, "unspecified_stereo_candidates": [], "decoder_steps": 10, "hypotheses": [ { "tokenIDs": [ 5, 12, 5, 6, 152, 7, 11, 9 ], "score": -0.616362452507019, "finishedAt": 8, "endedWithEOS": true }, { "tokenIDs": [ 152, 5, 6, 11, 9, 7, 12, 5 ], "score": -1.3655260801315308, "finishedAt": 8, "endedWithEOS": true }, { "tokenIDs": [ 5, 12, 5, 6, 11, 9, 7, 152 ], "score": -2.162733316421509, "finishedAt": 8, "endedWithEOS": true }, { "tokenIDs": [ 9, 11, 5, 6, 152, 7, 12, 5 ], "score": -4.623570919036865, "finishedAt": 8, "endedWithEOS": true }, { "tokenIDs": [ 152, 5, 6, 11, 9, 7, 12, 5, 5 ], "score": -10.84195327758789, "finishedAt": 9, "endedWithEOS": true } ], "trace": [ { "step": 0, "inputTokenIDs": [ 2 ], "topCandidateParents": [ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ], "topCandidateTokenIDs": [ 5, 152, 9, 12, 39, 23, 89, 158, 85, 94 ], "topCandidateScores": [ -0.37902897596359253, -1.3313264846801758, -4.421975135803223, -4.714287281036377, -4.8933844566345215, -4.989068508148193, -5.681975364685059, -6.30527925491333, -7.0588507652282715, -7.251871585845947 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.09568405151367188 }, { "step": 1, "inputTokenIDs": [ 5, 152, 9, 12, 39 ], "topCandidateParents": [ 0, 1, 0, 2, 3, 4, 0, 0, 1, 1 ], "topCandidateTokenIDs": [ 12, 5, 6, 11, 6, 5, 5, 27, 27, 12 ], "topCandidateScores": [ -0.41232427954673767, -1.3370130062103271, -3.887922763824463, -4.428440570831299, -4.718957424163818, -4.901465892791748, -7.003505229949951, -7.584750175476074, -7.692673206329346, -8.031330108642578 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.1825084686279297 }, { "step": 2, "inputTokenIDs": [ 12, 5, 6, 11, 6 ], "topCandidateParents": [ 0, 1, 3, 2, 4, 2, 0, 2, 2, 2 ], "topCandidateTokenIDs": [ 5, 6, 5, 11, 5, 12, 6, 38, 152, 158 ], "topCandidateScores": [ -0.419620156288147, -1.3371518850326538, -4.448358058929443, -4.522746562957764, -4.74265193939209, -5.573450565338135, -5.835132598876953, -6.081153869628906, -6.328573226928711, -7.136078357696533 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.8307986259460449 }, { "step": 3, "inputTokenIDs": [ 5, 6, 5, 11, 5 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 4, 1, 1, 0, 1 ], "topCandidateTokenIDs": [ 6, 11, 6, 9, 7, 6, 152, 12, 3, 39 ], "topCandidateScores": [ -0.4198084771633148, -1.3488285541534424, -4.448727130889893, -4.525534152984619, -5.28941011428833, -5.608728885650635, -6.41107702255249, -6.709597110748291, -9.47951602935791, -9.920477867126465 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.3193187713623047 }, { "step": 4, "inputTokenIDs": [ 6, 11, 6, 9, 7 ], "topCandidateParents": [ 0, 1, 0, 3, 2, 4, 2, 0, 2, 1 ], "topCandidateTokenIDs": [ 152, 9, 11, 7, 152, 5, 158, 75, 27, 21 ], "topCandidateScores": [ -0.6156101822853088, -1.3495264053344727, -2.15415096282959, -4.525534629821777, -4.5971550941467285, -5.300177097320557, -6.801499843597412, -7.713366508483887, -8.739667892456055, -8.828577995300293 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.7030220031738281 }, { "step": 5, "inputTokenIDs": [ 152, 9, 11, 7, 152 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 2, 2, 2, 2, 2 ], "topCandidateTokenIDs": [ 7, 7, 9, 6, 7, 21, 57, 152, 63, 7 ], "topCandidateScores": [ -0.6156103014945984, -1.3495265245437622, -2.156116247177124, -4.5257463455200195, -4.597156047821045, -8.618562698364258, -11.156744003295898, -11.227124214172363, -12.006502151489258, -12.284553527832031 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 4.021406650543213 }, { "step": 6, "inputTokenIDs": [ 7, 7, 9, 6, 7 ], "topCandidateParents": [ 0, 1, 2, 4, 3, 3, 3, 0, 1, 1 ], "topCandidateTokenIDs": [ 11, 12, 7, 12, 152, 158, 27, 6, 42, 27 ], "topCandidateScores": [ -0.6157974600791931, -1.3501064777374268, -2.1561222076416016, -4.597774028778076, -4.651209354400635, -6.972877025604248, -9.094228744506836, -9.241460800170898, -10.25013542175293, -10.464442253112793 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 2.3216676712036133 }, { "step": 7, "inputTokenIDs": [ 11, 12, 7, 12, 152 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 1, 2, 3, 0, 1 ], "topCandidateTokenIDs": [ 9, 5, 152, 5, 7, 6, 158, 6, 21, 3 ], "topCandidateScores": [ -0.6163622140884399, -1.365340232849121, -2.1627254486083984, -4.623412132263184, -4.651216983795166, -5.575643539428711, -7.210779190063477, -8.313026428222656, -8.582939147949219, -10.030013084411621 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.9244265556335449 }, { "step": 8, "inputTokenIDs": [ 9, 5, 152, 5, 7 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 1, 1, 1, 4, 4 ], "topCandidateTokenIDs": [ 3, 3, 3, 3, 12, 5, 6, 23, 27, 42 ], "topCandidateScores": [ -0.616362452507019, -1.3655260801315308, -2.162733316421509, -4.623570919036865, -4.652376651763916, -10.594195365905762, -11.632491111755371, -12.413251876831055, -12.681180953979492, -13.002037048339844 ], "activeCandidateIndices": [ 5, 6, 7, 8, 4 ], "finished": [ { "tokenIDs": [ 5, 12, 5, 6, 152, 7, 11, 9 ], "score": -0.616362452507019, "finishedAt": 8, "endedWithEOS": true }, { "tokenIDs": [ 152, 5, 6, 11, 9, 7, 12, 5 ], "score": -1.3655260801315308, "finishedAt": 8, "endedWithEOS": true }, { "tokenIDs": [ 5, 12, 5, 6, 11, 9, 7, 152 ], "score": -2.162733316421509, "finishedAt": 8, "endedWithEOS": true }, { "tokenIDs": [ 9, 11, 5, 6, 152, 7, 12, 5 ], "score": -4.623570919036865, "finishedAt": 8, "endedWithEOS": true } ], "exactTiesInTopCandidates": 0, "beamCutoffGap": 5.941818714141846 }, { "step": 9, "inputTokenIDs": [ 5, 6, 23, 27, 12 ], "topCandidateParents": [ 4, 4, 0, 1, 2, 0, 3, 1, 4, 0 ], "topCandidateTokenIDs": [ 5, 6, 3, 152, 3, 6, 12, 5, 3, 5 ], "topCandidateScores": [ -4.667408466339111, -8.900179862976074, -10.84195327758789, -12.355938911437988, -12.413251876831055, -12.562736511230469, -12.711265563964844, -12.766220092773438, -12.850662231445312, -13.89510726928711 ], "activeCandidateIndices": [ 0, 1, 5, 3, 6 ], "finished": [ { "tokenIDs": [ 152, 5, 6, 11, 9, 7, 12, 5, 5 ], "score": -10.84195327758789, "finishedAt": 9, "endedWithEOS": true }, { "tokenIDs": [ 152, 5, 6, 11, 9, 7, 12, 5, 23 ], "score": -12.413251876831055, "finishedAt": 9, "endedWithEOS": true } ], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.14948463439941406 } ], "compute_seconds": 0.06610000002384185, "runtime_evidence": { "ortWasmLinearMemoryBytes": 290717696, "rdkitWasmLinearMemoryBytes": 16777216, "gpuProfileEvents": 0, "gpuKernelTypes": [], "gpuMemoryBytes": null, "gpuQueueSubmissions": 0, "gpuComputePipelines": 0, "gpuDeviceLost": null, "peakResidentBytes": null, "cpuSeconds": null, "physicalDevicePerformance": false }, "kind": "prediction", "method": "ASKCOS Augmented Transformer · Pistachio 23Q3", "source_url": "https://github.com/ASKCOS/augmented_transformer", "precision": "FP32", "execution_target": "browser", "scope": "Predicted candidates; reaction conditions and experimental yield are not modeled." } }, { "id": "charged-amine", "status": "passed", "networkBytes": 0, "receipt": { "identity": { "taskId": "candidate-prediction:baa99416-fd06-41a8-80c5-be49a035d183", "attemptId": "attempt:9a873f1e-1717-42f6-9097-19721cd458ab", "generation": 1 }, "taskType": "reaction.product-prediction", "scientificProfileDigest": "72a1584ff8787ad3e0ed91021c054ef4b8869cdd79082c08f3f0561371240177", "implementationDigest": "9ba10bb450b9fc412dfc6acdcf2d8761fe6507645cc3265484b791dcde8622fa", "qualificationId": "prediction-fp32-q3-v2-product-v1", "normalizedInputHash": "379a1a116ec7d73798cb6c75beb33bf1b5459c6fe6bf1d271d98575c5e0d1fc8", "device": { "id": "candidate-prediction", "target": "browser", "class": "desktop", "connection": "online", "protocolVersion": 1, "implementationDigests": [ "9ba10bb450b9fc412dfc6acdcf2d8761fe6507645cc3265484b791dcde8622fa" ] }, "sourceReceipts": [ { "kind": "runtime", "build": "rolldown-1.0.3:sha256:db763a3d22d5a2b4c47dceca233f1d6bab58d76ab1e8a2302371f3c591cdf842", "concurrency": 1, "variant": "serial", "memoryBudgetBytes": 1610612736 } ], "parentResults": [], "startedAt": "2026-10-10T00:20:08.104Z", "endedAt": "2026-10-10T00:20:08.228Z", "wallSeconds": 0.124, "cpuSeconds": null, "peakResidentBytes": null, "quality": "complete", "warnings": [ "Model vocabulary does not cover: [Cl-]" ] }, "payload": { "reactants": "CC(=O)Cl.C[NH3+].[Cl-]", "candidates": [ { "smiles": "CNC(C)=O", "formula": "C3H7NO", "model_score": -2.7564377784729004, "rank": 1 } ], "rejected_candidates": 4, "unknown_tokens": [ "[Cl-]" ], "conditions_modeled": false, "unspecified_stereo_candidates": [], "decoder_steps": 19, "hypotheses": [ { "tokenIDs": [ 5, 12, 6, 5, 7, 5, 6, 5, 7, 11, 9 ], "score": -1.3078057765960693, "finishedAt": 11, "endedWithEOS": true }, { "tokenIDs": [ 5, 5, 6, 11, 9, 7, 12, 6, 5, 7, 5 ], "score": -1.3574632406234741, "finishedAt": 11, "endedWithEOS": true }, { "tokenIDs": [ 5, 12, 5, 6, 5, 7, 11, 9 ], "score": -2.7564377784729004, "finishedAt": 8, "endedWithEOS": true }, { "tokenIDs": [ 5, 12, 6, 5, 7, 5, 6, 11, 9, 7, 5, 17 ], "score": -3.533766269683838, "finishedAt": 12, "endedWithEOS": true }, { "tokenIDs": [ 5, 12, 6, 5, 7, 5, 6, 11, 9, 7, 5, 6, 5, 7, 6, 5, 7, 5 ], "score": -6.143874168395996, "finishedAt": 18, "endedWithEOS": true } ], "trace": [ { "step": 0, "inputTokenIDs": [ 2 ], "topCandidateParents": [ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ], "topCandidateTokenIDs": [ 5, 12, 9, 45, 4, 39, 17, 94, 85, 99 ], "topCandidateScores": [ -0.02179539017379284, -5.1555495262146, -5.336862564086914, -5.671944618225098, -6.137184143066406, -6.830463409423828, -6.926329612731934, -6.997121810913086, -7.703906059265137, -7.80108642578125 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.6932792663574219 }, { "step": 1, "inputTokenIDs": [ 5, 12, 9, 45, 4 ], "topCandidateParents": [ 0, 0, 0, 1, 2, 0, 3, 0, 0, 4 ], "topCandidateTokenIDs": [ 12, 5, 6, 6, 11, 11, 12, 4, 9, 8 ], "topCandidateScores": [ -0.4871646463871002, -1.0838286876678467, -4.578472137451172, -5.40565299987793, -5.418433666229248, -5.736665725708008, -5.768835067749023, -5.870017051696777, -5.963783264160156, -6.137184143066406 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.31823205947875977 }, { "step": 2, "inputTokenIDs": [ 12, 5, 6, 6, 11 ], "topCandidateParents": [ 0, 1, 0, 1, 1, 3, 4, 2, 2, 2 ], "topCandidateTokenIDs": [ 6, 6, 5, 12, 5, 5, 5, 12, 5, 11 ], "topCandidateScores": [ -0.8927406072616577, -1.1247148513793945, -1.617559790611267, -4.827018737792969, -5.389132499694824, -5.427435398101807, -5.464460372924805, -5.558150291442871, -5.688814640045166, -5.9096784591674805 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.03830289840698242 }, { "step": 3, "inputTokenIDs": [ 6, 6, 5, 12, 5 ], "topCandidateParents": [ 0, 1, 2, 3, 2, 4, 4, 3, 4, 0 ], "topCandidateTokenIDs": [ 5, 11, 6, 6, 5, 5, 6, 5, 12, 9 ], "topCandidateScores": [ -0.8962951898574829, -1.1254549026489258, -1.6408940553665161, -4.953165054321289, -5.6450982093811035, -5.983138084411621, -6.545350551605225, -6.998263835906982, -7.799435615539551, -7.956784248352051 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.3380398750305176 }, { "step": 4, "inputTokenIDs": [ 5, 11, 6, 6, 5 ], "topCandidateParents": [ 0, 1, 2, 2, 0, 3, 0, 4, 4, 0 ], "topCandidateTokenIDs": [ 7, 9, 11, 5, 6, 5, 5, 6, 5, 11 ], "topCandidateScores": [ -0.9330440163612366, -1.1262882947921753, -2.0482757091522217, -2.7367634773254395, -4.420986652374268, -4.954501152038574, -6.388769626617432, -6.514915466308594, -6.615079879760742, -7.684640884399414 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.5335144996643066 }, { "step": 5, "inputTokenIDs": [ 7, 9, 11, 5, 6 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 0, 0, 0, 0, 4 ], "topCandidateTokenIDs": [ 5, 7, 9, 7, 5, 27, 37, 4, 21, 11 ], "topCandidateScores": [ -0.9616532921791077, -1.1262885332107544, -2.0493571758270264, -2.7389185428619385, -4.4888811111450195, -5.482327938079834, -6.0661492347717285, -6.185691833496094, -6.890139102935791, -7.167579650878906 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.9934468269348145 }, { "step": 6, "inputTokenIDs": [ 5, 7, 9, 7, 5 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 0, 0, 0, 0, 3 ], "topCandidateTokenIDs": [ 6, 12, 7, 11, 7, 5, 11, 4, 8, 5 ], "topCandidateScores": [ -0.9878914952278137, -1.1289763450622559, -2.0493571758270264, -2.7482285499572754, -4.489781379699707, -5.173694133758545, -6.115869045257568, -6.914270401000977, -7.491898536682129, -7.776546478271484 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.6839127540588379 }, { "step": 7, "inputTokenIDs": [ 6, 12, 7, 11, 7 ], "topCandidateParents": [ 1, 0, 2, 0, 3, 4, 1, 2, 2, 2 ], "topCandidateTokenIDs": [ 6, 5, 5, 11, 9, 11, 5, 4, 27, 12 ], "topCandidateScores": [ -1.132767915725708, -1.3062236309051514, -2.0711774826049805, -2.2915284633636475, -2.7564377784729004, -4.490401744842529, -6.787575721740723, -6.876263618469238, -6.898667335510254, -7.438495635986328 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 1.733963966369629 }, { "step": 8, "inputTokenIDs": [ 6, 5, 5, 11, 9 ], "topCandidateParents": [ 0, 1, 3, 4, 2, 2, 2, 2, 2, 2 ], "topCandidateTokenIDs": [ 5, 7, 9, 3, 5, 6, 4, 17, 12, 21 ], "topCandidateScores": [ -1.1329193115234375, -1.306678295135498, -2.2922303676605225, -2.7564377784729004, -3.0131454467773438, -3.9629673957824707, -4.22285795211792, -4.452600479125977, -4.461583614349365, -5.6795654296875 ], "activeCandidateIndices": [ 0, 1, 2, 5, 4 ], "finished": [ { "tokenIDs": [ 5, 12, 5, 6, 5, 7, 11, 9 ], "score": -2.7564377784729004, "finishedAt": 8, "endedWithEOS": true } ], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.949821949005127 }, { "step": 9, "inputTokenIDs": [ 5, 7, 9, 6, 5 ], "topCandidateParents": [ 0, 1, 2, 4, 3, 4, 4, 4, 4, 4 ], "topCandidateTokenIDs": [ 7, 11, 7, 5, 5, 6, 3, 12, 4, 8 ], "topCandidateScores": [ -1.1338260173797607, -1.307225227355957, -2.2922303676605225, -3.570235252380371, -4.079377174377441, -5.170539379119873, -5.195133209228516, -5.432302951812744, -6.430620193481445, -6.595868110656738 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 1.0911622047424316 }, { "step": 10, "inputTokenIDs": [ 7, 11, 7, 5, 5 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 3, 3, 2, 2, 2 ], "topCandidateTokenIDs": [ 5, 9, 5, 5, 7, 6, 12, 27, 12, 4 ], "topCandidateScores": [ -1.1419628858566284, -1.3078056573867798, -2.329723596572876, -3.7783682346343994, -4.105456829071045, -6.210323333740234, -6.4261016845703125, -6.716009140014648, -6.757055282592773, -7.068193435668945 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 2.1048665046691895 }, { "step": 11, "inputTokenIDs": [ 5, 9, 5, 5, 7 ], "topCandidateParents": [ 1, 0, 0, 2, 2, 3, 2, 0, 2, 2 ], "topCandidateTokenIDs": [ 3, 3, 5, 17, 5, 5, 6, 6, 11, 12 ], "topCandidateScores": [ -1.3078057765960693, -1.3574632406234741, -3.139754295349121, -3.533766269683838, -3.8248963356018066, -3.990696430206299, -4.309256553649902, -4.634090423583984, -4.739921569824219, -5.012323379516602 ], "activeCandidateIndices": [ 5, 6, 2, 3, 4 ], "finished": [ { "tokenIDs": [ 5, 12, 6, 5, 7, 5, 6, 5, 7, 11, 9 ], "score": -1.3078057765960693, "finishedAt": 11, "endedWithEOS": true }, { "tokenIDs": [ 5, 5, 6, 11, 9, 7, 12, 6, 5, 7, 5 ], "score": -1.3574632406234741, "finishedAt": 11, "endedWithEOS": true } ], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.1658000946044922 }, { "step": 12, "inputTokenIDs": [ 5, 6, 5, 17, 5 ], "topCandidateParents": [ 3, 2, 4, 0, 1, 2, 0, 2, 4, 2 ], "topCandidateTokenIDs": [ 3, 5, 5, 5, 5, 6, 12, 3, 6, 9 ], "topCandidateScores": [ -3.533766269683838, -3.962198495864868, -4.343798637390137, -4.594907760620117, -4.660830497741699, -5.278732776641846, -5.349813938140869, -5.482929229736328, -5.52237606048584, -5.553861618041992 ], "activeCandidateIndices": [ 5, 1, 2, 3, 4 ], "finished": [ { "tokenIDs": [ 5, 12, 6, 5, 7, 5, 6, 11, 9, 7, 5, 17 ], "score": -3.533766269683838, "finishedAt": 12, "endedWithEOS": true } ], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.6179022789001465 }, { "step": 13, "inputTokenIDs": [ 6, 5, 5, 5, 5 ], "topCandidateParents": [ 1, 4, 2, 3, 0, 2, 1, 0, 1, 3 ], "topCandidateTokenIDs": [ 5, 7, 5, 5, 11, 6, 17, 5, 12, 12 ], "topCandidateScores": [ -4.399850845336914, -4.675102710723877, -4.763458251953125, -5.045472145080566, -5.854452133178711, -6.107134819030762, -6.223923206329346, -6.2673444747924805, -6.311579704284668, -6.482204437255859 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.2526826858520508 }, { "step": 14, "inputTokenIDs": [ 5, 7, 5, 5, 11 ], "topCandidateParents": [ 0, 2, 1, 3, 4, 1, 0, 0, 2, 1 ], "topCandidateTokenIDs": [ 5, 5, 6, 5, 9, 5, 17, 6, 6, 11 ], "topCandidateScores": [ -4.878066539764404, -5.0723042488098145, -5.370282173156738, -5.418604373931885, -5.857264041900635, -6.426913261413574, -6.445793151855469, -6.657768249511719, -6.816539287567139, -6.881216049194336 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.5696492195129395 }, { "step": 15, "inputTokenIDs": [ 5, 5, 6, 5, 9 ], "topCandidateParents": [ 0, 2, 3, 1, 4, 1, 1, 0, 0, 0 ], "topCandidateTokenIDs": [ 5, 5, 5, 5, 7, 12, 23, 23, 6, 17 ], "topCandidateScores": [ -5.166599750518799, -5.431142807006836, -5.6770758628845215, -5.769603252410889, -5.857264041900635, -6.860652446746826, -6.966000080108643, -7.673097133636475, -7.705267429351807, -7.726973056793213 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 1.0033884048461914 }, { "step": 16, "inputTokenIDs": [ 5, 5, 5, 5, 7 ], "topCandidateParents": [ 1, 0, 2, 3, 4, 0, 4, 0, 3, 0 ], "topCandidateTokenIDs": [ 7, 5, 5, 5, 12, 17, 9, 23, 23, 6 ], "topCandidateScores": [ -5.4515862464904785, -5.7986602783203125, -5.86509895324707, -6.31177282333374, -6.362484931945801, -7.0790300369262695, -7.484484672546387, -7.5282440185546875, -7.5843048095703125, -7.674191474914551 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.7165451049804688 }, { "step": 17, "inputTokenIDs": [ 7, 5, 5, 5, 12 ], "topCandidateParents": [ 0, 2, 1, 4, 3, 0, 1, 1, 0, 0 ], "topCandidateTokenIDs": [ 5, 5, 5, 6, 5, 12, 17, 23, 23, 4 ], "topCandidateScores": [ -5.906002044677734, -6.010981559753418, -6.394316673278809, -6.407170295715332, -6.734740734100342, -7.465578079223633, -7.643708229064941, -7.907476425170898, -8.017215728759766, -8.300736427307129 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.730837345123291 }, { "step": 18, "inputTokenIDs": [ 5, 5, 5, 6, 5 ], "topCandidateParents": [ 1, 0, 3, 2, 4, 0, 2, 0, 2, 2 ], "topCandidateTokenIDs": [ 5, 3, 5, 5, 5, 5, 17, 12, 23, 6 ], "topCandidateScores": [ -6.139590740203857, -6.143874168395996, -6.407495498657227, -6.807612419128418, -7.070250511169434, -8.232442855834961, -8.656580924987793, -8.799623489379883, -8.902233123779297, -9.022008895874023 ], "activeCandidateIndices": [ 0, 5, 2, 3, 4 ], "finished": [ { "tokenIDs": [ 5, 12, 6, 5, 7, 5, 6, 11, 9, 7, 5, 6, 5, 7, 6, 5, 7, 5 ], "score": -6.143874168395996, "finishedAt": 18, "endedWithEOS": true } ], "exactTiesInTopCandidates": 0, "beamCutoffGap": 1.1621923446655273 } ], "compute_seconds": 0.12040000003576279, "runtime_evidence": { "ortWasmLinearMemoryBytes": 290717696, "rdkitWasmLinearMemoryBytes": 16777216, "gpuProfileEvents": 0, "gpuKernelTypes": [], "gpuMemoryBytes": null, "gpuQueueSubmissions": 0, "gpuComputePipelines": 0, "gpuDeviceLost": null, "peakResidentBytes": null, "cpuSeconds": null, "physicalDevicePerformance": false }, "kind": "prediction", "method": "ASKCOS Augmented Transformer · Pistachio 23Q3", "source_url": "https://github.com/ASKCOS/augmented_transformer", "precision": "FP32", "execution_target": "browser", "scope": "Predicted candidates; reaction conditions and experimental yield are not modeled." } }, { "id": "heteroaromatic-amine", "status": "passed", "networkBytes": 0, "receipt": { "identity": { "taskId": "candidate-prediction:c0674b64-a933-4c1c-9dda-3bcc8a516f8a", "attemptId": "attempt:12ff187f-f3b1-42a1-bdca-c5c74602faff", "generation": 1 }, "taskType": "reaction.product-prediction", "scientificProfileDigest": "72a1584ff8787ad3e0ed91021c054ef4b8869cdd79082c08f3f0561371240177", "implementationDigest": "9ba10bb450b9fc412dfc6acdcf2d8761fe6507645cc3265484b791dcde8622fa", "qualificationId": "prediction-fp32-q3-v2-product-v1", "normalizedInputHash": "50ea9fab3056982f83e826176adc51d45e89dc6dc3b5887dff986b1c3386a3de", "device": { "id": "candidate-prediction", "target": "browser", "class": "desktop", "connection": "online", "protocolVersion": 1, "implementationDigests": [ "9ba10bb450b9fc412dfc6acdcf2d8761fe6507645cc3265484b791dcde8622fa" ] }, "sourceReceipts": [ { "kind": "runtime", "build": "rolldown-1.0.3:sha256:db763a3d22d5a2b4c47dceca233f1d6bab58d76ab1e8a2302371f3c591cdf842", "concurrency": 1, "variant": "serial", "memoryBudgetBytes": 1610612736 } ], "parentResults": [], "startedAt": "2026-10-10T00:20:08.291Z", "endedAt": "2026-10-10T00:20:08.426Z", "wallSeconds": 0.135, "cpuSeconds": null, "peakResidentBytes": null, "quality": "complete", "warnings": [] }, "payload": { "reactants": "CC(=O)Cl.Nc1nccs1", "candidates": [ { "smiles": "CC(=O)Nc1nccs1", "formula": "C5H6N2OS", "model_score": -0.04436143487691879, "rank": 1 }, { "smiles": "CC(=O)c1cnc(N)s1", "formula": "C5H6N2OS", "model_score": -5.038079261779785, "rank": 2 }, { "smiles": "CC(=O)Nc1cncs1", "formula": "C5H6N2OS", "model_score": -6.837806701660156, "rank": 3 } ], "rejected_candidates": 2, "unknown_tokens": [], "conditions_modeled": false, "unspecified_stereo_candidates": [], "decoder_steps": 20, "hypotheses": [ { "tokenIDs": [ 5, 5, 6, 11, 9, 7, 12, 4, 8, 13, 4, 4, 26, 8 ], "score": -0.04436143487691879, "finishedAt": 14, "endedWithEOS": true }, { "tokenIDs": [ 5, 5, 6, 11, 9, 7, 4, 8, 4, 13, 4, 6, 12, 7, 26, 8 ], "score": -5.038079261779785, "finishedAt": 16, "endedWithEOS": true }, { "tokenIDs": [ 5, 5, 6, 11, 9, 7, 12, 4, 8, 4, 13, 4, 26, 8 ], "score": -6.837806701660156, "finishedAt": 14, "endedWithEOS": true }, { "tokenIDs": [ 5, 5, 6, 11, 9, 7, 12, 4, 8, 13, 4, 4, 6, 5, 7, 26, 8 ], "score": -8.78159236907959, "finishedAt": 17, "endedWithEOS": true }, { "tokenIDs": [ 5, 5, 6, 11, 9, 7, 12, 4, 8, 13, 4, 4, 6, 5, 11, 9, 7, 26, 8 ], "score": -9.603529930114746, "finishedAt": 19, "endedWithEOS": true } ], "trace": [ { "step": 0, "inputTokenIDs": [ 2 ], "topCandidateParents": [ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ], "topCandidateTokenIDs": [ 5, 4, 9, 12, 13, 17, 26, 23, 21, 14 ], "topCandidateScores": [ -0.010117082856595516, -5.6050310134887695, -5.646274566650391, -6.164137363433838, -8.300726890563965, -8.404688835144043, -9.779731750488281, -10.134243965148926, -10.210295677185059, -10.636009216308594 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.10396194458007812 }, { "step": 1, "inputTokenIDs": [ 5, 4, 9, 12, 13 ], "topCandidateParents": [ 0, 1, 2, 0, 0, 3, 0, 3, 3, 0 ], "topCandidateTokenIDs": [ 5, 8, 11, 6, 9, 5, 4, 6, 4, 12 ], "topCandidateScores": [ -0.014807086437940598, -5.6050310134887695, -5.669670581817627, -6.271069049835205, -6.64249849319458, -6.768908977508545, -7.338840961456299, -7.560898303985596, -8.002985954284668, -8.009814262390137 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.12641048431396484 }, { "step": 2, "inputTokenIDs": [ 5, 8, 11, 6, 9 ], "topCandidateParents": [ 0, 2, 1, 4, 1, 3, 3, 1, 3, 1 ], "topCandidateTokenIDs": [ 6, 5, 4, 5, 6, 5, 11, 13, 12, 26 ], "topCandidateScores": [ -0.016186697408556938, -5.701662540435791, -6.526979446411133, -6.798181056976318, -6.850807189941406, -7.291585922241211, -7.391945838928223, -7.429990768432617, -7.450237274169922, -7.491615295410156 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.4407787322998047 }, { "step": 3, "inputTokenIDs": [ 6, 5, 4, 5, 6 ], "topCandidateParents": [ 0, 1, 3, 2, 2, 4, 4, 4, 0, 1 ], "topCandidateTokenIDs": [ 11, 6, 6, 26, 13, 12, 26, 13, 12, 8 ], "topCandidateScores": [ -0.016441773623228073, -5.809057712554932, -6.858371257781982, -7.055532932281494, -7.536966323852539, -7.713715553283691, -8.184694290161133, -8.332415580749512, -8.778519630432129, -8.987990379333496 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.17674922943115234 }, { "step": 4, "inputTokenIDs": [ 11, 6, 6, 26, 13 ], "topCandidateParents": [ 0, 1, 2, 3, 1, 4, 1, 1, 0, 2 ], "topCandidateTokenIDs": [ 9, 5, 11, 4, 12, 4, 17, 9, 21, 5 ], "topCandidateScores": [ -0.01652354747056961, -6.186221122741699, -6.902350425720215, -7.057220935821533, -7.485031604766846, -7.569016456604004, -8.619322776794434, -8.836441040039062, -9.633191108703613, -10.054939270019531 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.0839848518371582 }, { "step": 5, "inputTokenIDs": [ 9, 5, 11, 4, 12 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 1, 1, 1, 1, 1 ], "topCandidateTokenIDs": [ 7, 4, 9, 6, 4, 17, 7, 13, 12, 5 ], "topCandidateScores": [ -0.01652366667985916, -6.8853254318237305, -6.906886100769043, -7.072333812713623, -7.540532112121582, -7.805861949920654, -8.509211540222168, -8.804866790771484, -9.636054039001465, -9.740239143371582 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.26532983779907227 }, { "step": 6, "inputTokenIDs": [ 7, 4, 9, 6, 4 ], "topCandidateParents": [ 0, 0, 0, 1, 2, 4, 3, 3, 0, 0 ], "topCandidateTokenIDs": [ 12, 4, 5, 8, 7, 8, 13, 12, 13, 9 ], "topCandidateScores": [ -0.026539020240306854, -4.884232997894287, -6.422255992889404, -6.8853254318237305, -6.906886100769043, -7.540532112121582, -7.765947341918945, -7.78710412979126, -8.090608596801758, -9.068415641784668 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.6336460113525391 }, { "step": 7, "inputTokenIDs": [ 12, 4, 5, 8, 7 ], "topCandidateParents": [ 0, 1, 0, 0, 0, 2, 3, 0, 4, 4 ], "topCandidateTokenIDs": [ 4, 8, 6, 5, 11, 8, 13, 8, 12, 4 ], "topCandidateScores": [ -0.03836824744939804, -4.884232997894287, -5.05499792098999, -6.212193489074707, -6.410769462585449, -6.693663597106934, -6.95398473739624, -7.086777687072754, -7.588947772979736, -7.9408063888549805 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.2828941345214844 }, { "step": 8, "inputTokenIDs": [ 4, 8, 6, 5, 11 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 1, 2, 3, 3, 3 ], "topCandidateTokenIDs": [ 8, 4, 5, 8, 4, 13, 4, 4, 6, 5 ], "topCandidateScores": [ -0.03836824744939804, -4.945408821105957, -5.086605072021484, -6.361085891723633, -6.416229248046875, -7.809295654296875, -8.881555557250977, -8.95956802368164, -9.395835876464844, -9.797386169433594 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 1.39306640625 }, { "step": 9, "inputTokenIDs": [ 8, 4, 5, 8, 4 ], "topCandidateParents": [ 0, 1, 2, 0, 4, 3, 3, 1, 0, 3 ], "topCandidateTokenIDs": [ 13, 13, 6, 4, 8, 11, 6, 26, 26, 12 ], "topCandidateScores": [ -0.04145505279302597, -4.997213840484619, -5.093627452850342, -5.885264873504639, -6.416229248046875, -6.793073654174805, -7.989260673522949, -8.329376220703125, -8.600375175476074, -8.749504089355469 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.3768444061279297 }, { "step": 10, "inputTokenIDs": [ 13, 13, 6, 4, 8 ], "topCandidateParents": [ 0, 1, 2, 3, 3, 4, 4, 3, 4, 0 ], "topCandidateTokenIDs": [ 4, 4, 5, 4, 13, 26, 25, 26, 13, 13 ], "topCandidateScores": [ -0.041538018733263016, -5.002594470977783, -5.09920597076416, -6.61631441116333, -6.817099094390869, -7.104754447937012, -7.385729789733887, -8.000121116638184, -8.559582710266113, -9.545263290405273 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.2876553535461426 }, { "step": 11, "inputTokenIDs": [ 4, 4, 5, 4, 13 ], "topCandidateParents": [ 0, 1, 2, 4, 3, 0, 3, 3, 3, 0 ], "topCandidateTokenIDs": [ 4, 6, 7, 4, 4, 6, 13, 26, 6, 26 ], "topCandidateScores": [ -0.042375948280096054, -5.005374431610107, -5.099213600158691, -6.822602272033691, -7.157077789306641, -7.3801445960998535, -8.154317855834961, -8.878503799438477, -9.351638793945312, -9.680839538574219 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.2230668067932129 }, { "step": 12, "inputTokenIDs": [ 4, 6, 7, 4, 4 ], "topCandidateParents": [ 0, 1, 2, 0, 3, 4, 4, 4, 4, 0 ], "topCandidateTokenIDs": [ 26, 12, 11, 6, 26, 26, 4, 6, 13, 29 ], "topCandidateScores": [ -0.04436131566762924, -5.009426593780518, -5.09926176071167, -6.297886371612549, -6.83780574798584, -7.558441638946533, -8.83326244354248, -9.871448516845703, -9.877481460571289, -10.651168823242188 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.7206358909606934 }, { "step": 13, "inputTokenIDs": [ 26, 12, 11, 6, 26 ], "topCandidateParents": [ 0, 1, 2, 4, 3, 3, 3, 1, 3, 3 ], "topCandidateTokenIDs": [ 8, 7, 9, 8, 5, 23, 28, 5, 17, 18 ], "topCandidateScores": [ -0.04436143487691879, -5.0380120277404785, -5.099279403686523, -6.837806701660156, -7.3545379638671875, -7.737653732299805, -7.839226722717285, -8.596651077270508, -8.624845504760742, -9.654115676879883 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.3831157684326172 }, { "step": 14, "inputTokenIDs": [ 8, 7, 9, 8, 5 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 4, 4, 4, 4, 4 ], "topCandidateTokenIDs": [ 3, 26, 7, 3, 6, 7, 11, 9, 4, 10 ], "topCandidateScores": [ -0.04436143487691879, -5.038079261779785, -5.099279403686523, -6.837806701660156, -7.942230701446533, -8.781305313110352, -9.599672317504883, -11.164351463317871, -11.43700885772705, -11.495199203491211 ], "activeCandidateIndices": [ 5, 1, 2, 6, 4 ], "finished": [ { "tokenIDs": [ 5, 5, 6, 11, 9, 7, 12, 4, 8, 13, 4, 4, 26, 8 ], "score": -0.04436143487691879, "finishedAt": 14, "endedWithEOS": true }, { "tokenIDs": [ 5, 5, 6, 11, 9, 7, 12, 4, 8, 4, 13, 4, 26, 8 ], "score": -6.837806701660156, "finishedAt": 14, "endedWithEOS": true } ], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.8390746116638184 }, { "step": 15, "inputTokenIDs": [ 7, 26, 7, 11, 6 ], "topCandidateParents": [ 1, 2, 4, 0, 3, 4, 2, 2, 4, 2 ], "topCandidateTokenIDs": [ 8, 4, 5, 26, 9, 11, 5, 71, 12, 13 ], "topCandidateScores": [ -5.038079261779785, -5.102334022521973, -8.017642974853516, -8.78159236907959, -9.60334587097168, -10.637395858764648, -11.290379524230957, -12.394597053527832, -13.686810493469238, -14.257975578308105 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 1.0340499877929688 }, { "step": 16, "inputTokenIDs": [ 8, 4, 5, 26, 9 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 2, 2, 2, 2, 2 ], "topCandidateTokenIDs": [ 3, 8, 7, 8, 7, 5, 6, 17, 24, 23 ], "topCandidateScores": [ -5.038079261779785, -5.102334022521973, -8.018386840820312, -8.78159236907959, -9.60334587097168, -16.41697120666504, -16.536237716674805, -17.273439407348633, -17.837677001953125, -17.97772216796875 ], "activeCandidateIndices": [ 5, 1, 2, 3, 4 ], "finished": [ { "tokenIDs": [ 5, 5, 6, 11, 9, 7, 4, 8, 4, 13, 4, 6, 12, 7, 26, 8 ], "score": -5.038079261779785, "finishedAt": 16, "endedWithEOS": true } ], "exactTiesInTopCandidates": 0, "beamCutoffGap": 6.813625335693359 }, { "step": 17, "inputTokenIDs": [ 5, 8, 7, 8, 7 ], "topCandidateParents": [ 1, 2, 3, 4, 1, 2, 2, 2, 2, 1 ], "topCandidateTokenIDs": [ 13, 11, 3, 26, 4, 6, 5, 4, 9, 26 ], "topCandidateScores": [ -5.105743885040283, -8.092144966125488, -8.78159236907959, -9.603529930114746, -10.827842712402344, -11.120100021362305, -12.057022094726562, -13.607112884521484, -13.729724884033203, -13.980301856994629 ], "activeCandidateIndices": [ 0, 1, 5, 3, 4 ], "finished": [ { "tokenIDs": [ 5, 5, 6, 11, 9, 7, 12, 4, 8, 13, 4, 4, 6, 5, 7, 26, 8 ], "score": -8.78159236907959, "finishedAt": 17, "endedWithEOS": true } ], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.29225730895996094 }, { "step": 18, "inputTokenIDs": [ 13, 11, 6, 26, 4 ], "topCandidateParents": [ 0, 1, 3, 4, 2, 4, 4, 0, 4, 0 ], "topCandidateTokenIDs": [ 4, 9, 8, 4, 5, 13, 26, 13, 6, 6 ], "topCandidateScores": [ -5.1058030128479, -8.092253684997559, -9.603529930114746, -11.060542106628418, -11.123123168945312, -12.622135162353516, -14.165916442871094, -14.93243408203125, -16.210847854614258, -17.67620277404785 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 1.4990119934082031 }, { "step": 19, "inputTokenIDs": [ 4, 9, 8, 4, 5 ], "topCandidateParents": [ 0, 1, 2, 4, 3, 0, 3, 3, 0, 3 ], "topCandidateTokenIDs": [ 4, 7, 3, 7, 4, 6, 13, 6, 10, 26 ], "topCandidateScores": [ -5.1064133644104, -8.092253684997559, -9.603529930114746, -11.12374496459961, -11.342040061950684, -12.920219421386719, -13.06544017791748, -13.973664283752441, -14.30923080444336, -14.441906929016113 ], "activeCandidateIndices": [ 0, 1, 5, 3, 4 ], "finished": [ { "tokenIDs": [ 5, 5, 6, 11, 9, 7, 12, 4, 8, 13, 4, 4, 6, 5, 11, 9, 7, 26, 8 ], "score": -9.603529930114746, "finishedAt": 19, "endedWithEOS": true } ], "exactTiesInTopCandidates": 0, "beamCutoffGap": 1.5781793594360352 } ], "compute_seconds": 0.13039999997615814, "runtime_evidence": { "ortWasmLinearMemoryBytes": 290717696, "rdkitWasmLinearMemoryBytes": 16777216, "gpuProfileEvents": 0, "gpuKernelTypes": [], "gpuMemoryBytes": null, "gpuQueueSubmissions": 0, "gpuComputePipelines": 0, "gpuDeviceLost": null, "peakResidentBytes": null, "cpuSeconds": null, "physicalDevicePerformance": false }, "kind": "prediction", "method": "ASKCOS Augmented Transformer · Pistachio 23Q3", "source_url": "https://github.com/ASKCOS/augmented_transformer", "precision": "FP32", "execution_target": "browser", "scope": "Predicted candidates; reaction conditions and experimental yield are not modeled." } }, { "id": "no-conditions-control", "status": "passed", "networkBytes": 0, "receipt": { "identity": { "taskId": "candidate-prediction:17fcd835-0bf2-4034-ba79-0804f5f5ce1c", "attemptId": "attempt:b372536b-95f4-4992-950c-212cc835e9a0", "generation": 1 }, "taskType": "reaction.product-prediction", "scientificProfileDigest": "72a1584ff8787ad3e0ed91021c054ef4b8869cdd79082c08f3f0561371240177", "implementationDigest": "9ba10bb450b9fc412dfc6acdcf2d8761fe6507645cc3265484b791dcde8622fa", "qualificationId": "prediction-fp32-q3-v2-product-v1", "normalizedInputHash": "cab504f4be54445553099026eff93e7f43c5a8e64a2b085b1e9d78c9d0cc85bf", "device": { "id": "candidate-prediction", "target": "browser", "class": "desktop", "connection": "online", "protocolVersion": 1, "implementationDigests": [ "9ba10bb450b9fc412dfc6acdcf2d8761fe6507645cc3265484b791dcde8622fa" ] }, "sourceReceipts": [ { "kind": "runtime", "build": "rolldown-1.0.3:sha256:db763a3d22d5a2b4c47dceca233f1d6bab58d76ab1e8a2302371f3c591cdf842", "concurrency": 1, "variant": "serial", "memoryBudgetBytes": 1610612736 } ], "parentResults": [], "startedAt": "2026-10-10T00:20:08.508Z", "endedAt": "2026-10-10T00:20:08.622Z", "wallSeconds": 0.114, "cpuSeconds": null, "peakResidentBytes": null, "quality": "complete", "warnings": [] }, "payload": { "reactants": "c1ccccc1", "candidates": [], "rejected_candidates": 5, "unknown_tokens": [], "conditions_modeled": false, "unspecified_stereo_candidates": [], "decoder_steps": 17, "hypotheses": [ { "tokenIDs": [ 4, 8, 4, 4, 4, 4, 4, 8, 5, 6, 11, 9, 7, 9 ], "score": -5.9206461906433105, "finishedAt": 14, "endedWithEOS": true }, { "tokenIDs": [ 4, 8, 4, 4, 4, 4, 4, 8, 5, 6, 11, 9, 7, 5 ], "score": -6.404961585998535, "finishedAt": 14, "endedWithEOS": true }, { "tokenIDs": [ 4, 8, 4, 4, 4, 4, 6, 4, 8, 7, 5, 6, 11, 9, 7, 9 ], "score": -6.820460319519043, "finishedAt": 16, "endedWithEOS": true }, { "tokenIDs": [ 4, 8, 4, 4, 4, 6, 4, 4, 8, 7, 5, 6, 11, 9, 7, 9 ], "score": -7.073812484741211, "finishedAt": 16, "endedWithEOS": true }, { "tokenIDs": [ 4, 8, 4, 4, 4, 4, 6, 4, 8, 7, 5, 6, 11, 9, 7, 5 ], "score": -7.12302303314209, "finishedAt": 16, "endedWithEOS": true } ], "trace": [ { "step": 0, "inputTokenIDs": [ 2 ], "topCandidateParents": [ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ], "topCandidateTokenIDs": [ 4, 5, 9, 17, 23, 21, 14, 39, 12, 30 ], "topCandidateScores": [ -0.6402977108955383, -1.3821778297424316, -2.2411558628082275, -3.643117666244507, -3.919578790664673, -4.098443984985352, -4.653931617736816, -5.150319576263428, -5.248193740844727, -5.24894380569458 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.1788651943206787 }, { "step": 1, "inputTokenIDs": [ 4, 5, 9, 17, 23 ], "topCandidateParents": [ 0, 1, 2, 1, 1, 4, 3, 1, 3, 2 ], "topCandidateTokenIDs": [ 8, 8, 11, 6, 5, 4, 4, 4, 74, 8 ], "topCandidateScores": [ -0.6402986645698547, -2.0596718788146973, -2.490931749343872, -2.855337142944336, -3.059305191040039, -4.037065505981445, -4.45736837387085, -4.981137275695801, -5.009748935699463, -5.040442943572998 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.9777603149414062 }, { "step": 2, "inputTokenIDs": [ 8, 8, 11, 6, 5 ], "topCandidateParents": [ 0, 0, 1, 2, 3, 2, 4, 1, 2, 0 ], "topCandidateTokenIDs": [ 4, 6, 5, 5, 5, 21, 6, 11, 28, 10 ], "topCandidateScores": [ -0.8652580976486206, -2.3968632221221924, -2.441892147064209, -3.1887669563293457, -3.523219585418701, -3.7407960891723633, -3.93263578414917, -3.9343056678771973, -4.088377475738525, -4.218640327453613 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.2175765037536621 }, { "step": 3, "inputTokenIDs": [ 4, 6, 5, 5, 5 ], "topCandidateParents": [ 0, 0, 2, 1, 3, 4, 1, 0, 3, 2 ], "topCandidateTokenIDs": [ 4, 6, 5, 4, 6, 5, 5, 10, 8, 6 ], "topCandidateScores": [ -1.083902359008789, -2.6324033737182617, -2.7679812908172607, -3.0880959033966064, -3.6641342639923096, -4.264726638793945, -4.406552314758301, -4.563815116882324, -4.586382865905762, -4.722438812255859 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.6005923748016357 }, { "step": 4, "inputTokenIDs": [ 4, 6, 5, 4, 6 ], "topCandidateParents": [ 0, 0, 2, 1, 3, 3, 1, 4, 0, 4 ], "topCandidateTokenIDs": [ 4, 6, 5, 4, 4, 6, 5, 9, 10, 5 ], "topCandidateScores": [ -1.3710178136825562, -2.588059902191162, -2.9988784790039062, -3.337181329727173, -3.4035322666168213, -4.41696310043335, -4.548254489898682, -4.606825828552246, -4.706024646759033, -4.871393203735352 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 1.0134308338165283 }, { "step": 5, "inputTokenIDs": [ 4, 6, 5, 4, 4 ], "topCandidateParents": [ 0, 0, 1, 2, 3, 4, 0, 1, 2, 3 ], "topCandidateTokenIDs": [ 4, 6, 4, 5, 4, 4, 10, 5, 6, 6 ], "topCandidateScores": [ -1.8041081428527832, -2.586699962615967, -3.284017562866211, -3.318972110748291, -3.558228015899658, -3.6147983074188232, -4.281623363494873, -4.337983131408691, -4.624904632568359, -4.978438854217529 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.05657029151916504 }, { "step": 6, "inputTokenIDs": [ 4, 6, 4, 5, 4 ], "topCandidateParents": [ 0, 0, 1, 2, 4, 3, 1, 3, 0, 2 ], "topCandidateTokenIDs": [ 4, 6, 4, 4, 4, 5, 5, 6, 10, 6 ], "topCandidateScores": [ -2.459649085998535, -2.667369842529297, -3.3574957847595215, -3.504770278930664, -3.702524423599243, -3.7629594802856445, -4.113975524902344, -4.491484642028809, -4.636456489562988, -4.922242164611816 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.06043505668640137 }, { "step": 7, "inputTokenIDs": [ 4, 6, 4, 4, 4 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 1, 4, 2, 1, 1 ], "topCandidateTokenIDs": [ 8, 4, 4, 4, 4, 5, 6, 6, 21, 28 ], "topCandidateScores": [ -2.45980167388916, -3.3280675411224365, -3.4897959232330322, -3.60091495513916, -4.044698238372803, -4.238321304321289, -4.953189849853516, -5.484593391418457, -5.48471212387085, -5.671115875244141 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.19362306594848633 }, { "step": 8, "inputTokenIDs": [ 8, 4, 4, 4, 4 ], "topCandidateParents": [ 1, 0, 2, 3, 4, 0, 0, 0, 0, 0 ], "topCandidateTokenIDs": [ 8, 5, 8, 8, 8, 3, 21, 28, 18, 9 ], "topCandidateScores": [ -3.3280794620513916, -3.40958309173584, -3.489800214767456, -3.600923538208008, -4.044700622558594, -4.2410054206848145, -4.395730495452881, -5.336073398590088, -5.370299339294434, -5.507942199707031 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.1963047981262207 }, { "step": 9, "inputTokenIDs": [ 8, 5, 8, 8, 8 ], "topCandidateParents": [ 0, 2, 3, 1, 4, 1, 1, 1, 3, 1 ], "topCandidateTokenIDs": [ 7, 7, 7, 6, 7, 5, 11, 8, 5, 3 ], "topCandidateScores": [ -3.429871082305908, -3.5906949043273926, -3.900815010070801, -4.010898113250732, -4.152186870574951, -5.112433433532715, -5.772428035736084, -6.082852363586426, -6.245965480804443, -6.551177978515625 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.9602465629577637 }, { "step": 10, "inputTokenIDs": [ 7, 7, 7, 6, 7 ], "topCandidateParents": [ 0, 1, 2, 3, 4, 3, 0, 1, 0, 1 ], "topCandidateTokenIDs": [ 5, 5, 5, 11, 5, 5, 21, 21, 28, 28 ], "topCandidateScores": [ -4.201247692108154, -4.328627109527588, -4.6455183029174805, -4.800207614898682, -4.914340019226074, -5.186896800994873, -5.345743656158447, -5.531133651733398, -5.619014739990234, -5.823396682739258 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.27255678176879883 }, { "step": 11, "inputTokenIDs": [ 5, 5, 5, 11, 5 ], "topCandidateParents": [ 0, 3, 1, 2, 4, 0, 1, 2, 4, 0 ], "topCandidateTokenIDs": [ 6, 9, 6, 6, 6, 5, 5, 5, 5, 8 ], "topCandidateScores": [ -4.80653190612793, -4.815492153167725, -4.889156341552734, -5.1645050048828125, -5.426555633544922, -5.858442783355713, -5.944393157958984, -6.34708309173584, -6.643303871154785, -6.673437595367432 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.431887149810791 }, { "step": 12, "inputTokenIDs": [ 6, 9, 6, 6, 6 ], "topCandidateParents": [ 1, 0, 2, 0, 2, 3, 3, 4, 4, 0 ], "topCandidateTokenIDs": [ 7, 11, 11, 5, 5, 11, 5, 11, 5, 9 ], "topCandidateScores": [ -4.815509796142578, -5.606209754943848, -5.726728916168213, -5.963033676147461, -5.993986129760742, -5.99904203414917, -6.230938911437988, -6.247507572174072, -6.497052192687988, -6.805177688598633 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.005055904388427734 }, { "step": 13, "inputTokenIDs": [ 7, 11, 11, 5, 5 ], "topCandidateParents": [ 0, 1, 2, 0, 4, 0, 3, 3, 4, 3 ], "topCandidateTokenIDs": [ 5, 9, 9, 9, 7, 4, 7, 6, 6, 5 ], "topCandidateScores": [ -5.523500442504883, -5.623661041259766, -5.7420878410339355, -5.832752227783203, -6.886509418487549, -6.902812480926514, -6.90615177154541, -7.110973358154297, -7.177347660064697, -7.57139778137207 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.016303062438964844 }, { "step": 14, "inputTokenIDs": [ 5, 9, 9, 9, 7 ], "topCandidateParents": [ 1, 2, 3, 0, 0, 0, 4, 4, 3, 4 ], "topCandidateTokenIDs": [ 7, 7, 3, 3, 6, 5, 11, 5, 5, 6 ], "topCandidateScores": [ -5.623679161071777, -5.742105007171631, -5.9206461906433105, -6.404961585998535, -6.668703556060791, -7.235744953155518, -7.416187286376953, -8.518657684326172, -8.530694961547852, -8.683439254760742 ], "activeCandidateIndices": [ 0, 1, 5, 6, 4 ], "finished": [ { "tokenIDs": [ 4, 8, 4, 4, 4, 4, 4, 8, 5, 6, 11, 9, 7, 9 ], "score": -5.9206461906433105, "finishedAt": 14, "endedWithEOS": true }, { "tokenIDs": [ 4, 8, 4, 4, 4, 4, 4, 8, 5, 6, 11, 9, 7, 5 ], "score": -6.404961585998535, "finishedAt": 14, "endedWithEOS": true } ], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.5670413970947266 }, { "step": 15, "inputTokenIDs": [ 7, 7, 5, 11, 6 ], "topCandidateParents": [ 0, 1, 0, 1, 3, 0, 1, 4, 4, 2 ], "topCandidateTokenIDs": [ 5, 5, 9, 9, 9, 4, 4, 11, 14, 5 ], "topCandidateScores": [ -6.2667083740234375, -6.330634593963623, -6.723140716552734, -6.973310947418213, -7.431913375854492, -7.730159759521484, -7.742083549499512, -7.959861755371094, -8.01219367980957, -8.12985610961914 ], "activeCandidateIndices": [ 0, 1, 2, 3, 4 ], "finished": [], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.2982463836669922 }, { "step": 16, "inputTokenIDs": [ 5, 5, 9, 9, 9 ], "topCandidateParents": [ 2, 3, 0, 1, 0, 4, 1, 0, 1, 2 ], "topCandidateTokenIDs": [ 3, 3, 3, 3, 6, 3, 6, 5, 5, 5 ], "topCandidateScores": [ -6.820460319519043, -7.073812484741211, -7.12302303314209, -7.162326335906982, -7.379355430603027, -7.431913375854492, -7.457229137420654, -8.068048477172852, -8.136999130249023, -9.273472785949707 ], "activeCandidateIndices": [ 6, 7, 8, 9, 4 ], "finished": [ { "tokenIDs": [ 4, 8, 4, 4, 4, 4, 6, 4, 8, 7, 5, 6, 11, 9, 7, 9 ], "score": -6.820460319519043, "finishedAt": 16, "endedWithEOS": true }, { "tokenIDs": [ 4, 8, 4, 4, 4, 6, 4, 4, 8, 7, 5, 6, 11, 9, 7, 9 ], "score": -7.073812484741211, "finishedAt": 16, "endedWithEOS": true }, { "tokenIDs": [ 4, 8, 4, 4, 4, 4, 6, 4, 8, 7, 5, 6, 11, 9, 7, 5 ], "score": -7.12302303314209, "finishedAt": 16, "endedWithEOS": true }, { "tokenIDs": [ 4, 8, 4, 4, 4, 6, 4, 4, 8, 7, 5, 6, 11, 9, 7, 5 ], "score": -7.162326335906982, "finishedAt": 16, "endedWithEOS": true } ], "exactTiesInTopCandidates": 0, "beamCutoffGap": 0.052557945251464844 } ], "compute_seconds": 0.1095, "runtime_evidence": { "ortWasmLinearMemoryBytes": 290717696, "rdkitWasmLinearMemoryBytes": 16777216, "gpuProfileEvents": 0, "gpuKernelTypes": [], "gpuMemoryBytes": null, "gpuQueueSubmissions": 0, "gpuComputePipelines": 0, "gpuDeviceLost": null, "peakResidentBytes": null, "cpuSeconds": null, "physicalDevicePerformance": false }, "kind": "prediction", "method": "ASKCOS Augmented Transformer · Pistachio 23Q3", "source_url": "https://github.com/ASKCOS/augmented_transformer", "precision": "FP32", "execution_target": "browser", "scope": "Predicted candidates; reaction conditions and experimental yield are not modeled." } }, { "id": "verified-cache-offline", "status": "passed", "networkBytes": 0, "receipt": { "identity": { "taskId": "candidate-prediction:2ec3e123-f72f-4080-a9ec-86c3c87631d7", "attemptId": "attempt:552a7661-140b-4929-bff9-0b6b4d1b9344", "generation": 1 }, "taskType": "reaction.product-prediction", "scientificProfileDigest": "72a1584ff8787ad3e0ed91021c054ef4b8869cdd79082c08f3f0561371240177", "implementationDigest": "9ba10bb450b9fc412dfc6acdcf2d8761fe6507645cc3265484b791dcde8622fa", "qualificationId": "prediction-fp32-q3-v2-product-v1", "normalizedInputHash": "29a9e3684a99ea0f3c3497b323d95d39713a8e6ce50472ad1d564e780589e688", "device": { "id": "candidate-prediction", "target": "browser", "class": "desktop", "connection": "online", "protocolVersion": 1, "implementationDigests": [ "9ba10bb450b9fc412dfc6acdcf2d8761fe6507645cc3265484b791dcde8622fa" ] }, "sourceReceipts": [ { "kind": "runtime", "build": "rolldown-1.0.3:sha256:db763a3d22d5a2b4c47dceca233f1d6bab58d76ab1e8a2302371f3c591cdf842", "concurrency": 1, "variant": "serial", "memoryBudgetBytes": 1610612736 } ], "parentResults": [], "startedAt": "2026-10-10T00:20:08.689Z", "endedAt": "2026-10-10T00:20:08.767Z", "wallSeconds": 0.078, "cpuSeconds": null, "peakResidentBytes": null, "quality": "complete", "warnings": [] } }, { "id": "cancel-no-late-result", "status": "passed", "state": "cancelled" }, { "id": "retry-after-cancel", "status": "passed", "receipt": { "identity": { "taskId": "candidate-prediction:abde0aec-adcb-4ea9-9869-f6707766c7e3", "attemptId": "attempt:e11d269d-bab2-49ef-b090-d1f74d3a909b", "generation": 1 }, "taskType": "reaction.product-prediction", "scientificProfileDigest": "72a1584ff8787ad3e0ed91021c054ef4b8869cdd79082c08f3f0561371240177", "implementationDigest": "9ba10bb450b9fc412dfc6acdcf2d8761fe6507645cc3265484b791dcde8622fa", "qualificationId": "prediction-fp32-q3-v2-product-v1", "normalizedInputHash": "29a9e3684a99ea0f3c3497b323d95d39713a8e6ce50472ad1d564e780589e688", "device": { "id": "candidate-prediction", "target": "browser", "class": "desktop", "connection": "online", "protocolVersion": 1, "implementationDigests": [ "9ba10bb450b9fc412dfc6acdcf2d8761fe6507645cc3265484b791dcde8622fa" ] }, "sourceReceipts": [ { "kind": "runtime", "build": "rolldown-1.0.3:sha256:db763a3d22d5a2b4c47dceca233f1d6bab58d76ab1e8a2302371f3c591cdf842", "concurrency": 1, "variant": "serial", "memoryBudgetBytes": 1610612736 } ], "parentResults": [], "startedAt": "2026-10-10T00:20:09.221Z", "endedAt": "2026-10-10T00:20:10.177Z", "wallSeconds": 0.956, "cpuSeconds": null, "peakResidentBytes": null, "quality": "complete", "warnings": [] } }, { "id": "invalid-ring", "status": "passed", "error": { "code": "scientific-calculation-failed", "message": "Select a compound or enter a valid SMILES structure.", "retry": "same-implementation" } }, { "id": "over-100-heavy", "status": "passed", "error": { "code": "scientific-calculation-failed", "message": "Prediction supports at most 100 heavy atoms in total.", "retry": "same-implementation" } } ], "assetMetrics": { "networkBytes": 0, "cacheHits": 30, "cacheWriteFailures": 0 }, "registeredInProduct": true, "gfn2ProductEnabled": false, "peakResidentBytes": null }, "accounting": "macOS Chromium Dedicated Worker; alternating pinned before/after distributions; repeat 0 warmup excluded; three subsequent trials per variant. Includes protocol, progress, compute, result transfer; excludes asset download, initialization, history storage and page rendering.", "sourceFiles": [ { "path": "output/browser-engine-fixes-20261010/RESULTS.json", "sha256": "00ae5bcf405c9ac0b939b96a374da2630886146d35564870fe224c2e837100c9", "bytes": 5266 }, { "path": "output/browser-engine-fixes-20261010/prediction-distribution-pair.json", "sha256": "2e7b53488f0807c057df169ac9c12728fc032d768461785e16522bfa79dea0c8", "bytes": 3650 }, { "path": "output/browser-engine-fixes-20261010/prediction-acceptance.json", "sha256": "63f917af555cf71c393361a21c353ec23b2d8c0dc2b6564f5b2e30463e8798f7", "bytes": 338194 }, { "path": "output/browser-engine-fixes-20261010/README.md", "sha256": "112f379c72dc2dd8419f3020d4587a9fd44b5483f10695008271dbcb591baca5", "bytes": 5467 }, { "path": "output/browser-engine-fixes-20261010/prediction-pair.json", "sha256": "a805a959e3364e494108e20243610ee7179ba7609f8ef7811fd41041022aa609", "bytes": 4308 } ], "stateReuseIsolation": { "status": "passed", "scope": "Actual Worker model execution; excludes download, initialization and UI; repeat 0 is warmup", "rows": [ { "id": "acyl-primary-amine", "repeat": 0, "variant": "before", "ms": 143, "steps": 11, "gather": { "calls": 170, "bytes": 14643200 }, "exact": true, "parentReorders": 10 }, { "id": "acyl-primary-amine", "repeat": 0, "variant": "after", "ms": 97.89999997615814, "steps": 11, "gather": { "calls": 89, "bytes": 5519360 }, "exact": true, "parentReorders": 10 }, { "id": "acyl-primary-amine", "repeat": 1, "variant": "after", "ms": 75.09999996423721, "steps": 11, "gather": { "calls": 89, "bytes": 5519360 }, "exact": true, "parentReorders": 10 }, { "id": "acyl-primary-amine", "repeat": 1, "variant": "before", "ms": 75.60000002384186, "steps": 11, "gather": { "calls": 170, "bytes": 14643200 }, "exact": true, "parentReorders": 10 }, { "id": "acyl-primary-amine", "repeat": 2, "variant": "before", "ms": 78.29999995231628, "steps": 11, "gather": { "calls": 170, "bytes": 14643200 }, "exact": true, "parentReorders": 10 }, { "id": "acyl-primary-amine", "repeat": 2, "variant": "after", "ms": 79, "steps": 11, "gather": { "calls": 89, "bytes": 5519360 }, "exact": true, "parentReorders": 10 }, { "id": "acyl-primary-amine", "repeat": 3, "variant": "after", "ms": 75.5, "steps": 11, "gather": { "calls": 89, "bytes": 5519360 }, "exact": true, "parentReorders": 10 }, { "id": "acyl-primary-amine", "repeat": 3, "variant": "before", "ms": 76.39999997615814, "steps": 11, "gather": { "calls": 170, "bytes": 14643200 }, "exact": true, "parentReorders": 10 }, { "id": "chiral-acylation", "repeat": 0, "variant": "before", "ms": 134.10000002384186, "steps": 19, "gather": { "calls": 306, "bytes": 47185920 }, "exact": true, "parentReorders": 18 }, { "id": "chiral-acylation", "repeat": 0, "variant": "after", "ms": 134.30000001192093, "steps": 19, "gather": { "calls": 153, "bytes": 15851520 }, "exact": true, "parentReorders": 18 }, { "id": "chiral-acylation", "repeat": 1, "variant": "after", "ms": 131.5, "steps": 19, "gather": { "calls": 153, "bytes": 15851520 }, "exact": true, "parentReorders": 18 }, { "id": "chiral-acylation", "repeat": 1, "variant": "before", "ms": 130, "steps": 19, "gather": { "calls": 306, "bytes": 47185920 }, "exact": true, "parentReorders": 18 }, { "id": "chiral-acylation", "repeat": 2, "variant": "before", "ms": 132.19999998807907, "steps": 19, "gather": { "calls": 306, "bytes": 47185920 }, "exact": true, "parentReorders": 18 }, { "id": "chiral-acylation", "repeat": 2, "variant": "after", "ms": 135.10000002384186, "steps": 19, "gather": { "calls": 153, "bytes": 15851520 }, "exact": true, "parentReorders": 18 }, { "id": "chiral-acylation", "repeat": 3, "variant": "after", "ms": 130.80000001192093, "steps": 19, "gather": { "calls": 153, "bytes": 15851520 }, "exact": true, "parentReorders": 18 }, { "id": "chiral-acylation", "repeat": 3, "variant": "before", "ms": 130.69999998807907, "steps": 19, "gather": { "calls": 306, "bytes": 47185920 }, "exact": true, "parentReorders": 18 } ] } }